Organic azides

Alfa Aesar™ Azidotri-n-Butyltin(IV), 95 %

Alfa Aesar™ Azidotri-n-Butyltin(IV), 95 %

CAS: 17846-68-3 Summenformel: C12H27N3Sn Molekulargewicht (g/mol): 332.079 MDL-Nummer: MFCD00216557 InChI-Schlüssel: JKVRTUCVPZTEQZ-UHFFFAOYSA-N Synonym: tributyltin azide, azidotributyltin iv, azidotributyltin, azidotributyl tin, tri-n-butylazidotin, azido tributyl stannane, azido tributyltin, tri-butyltin azide, tributyl tin azide, tributylstannylazide PubChem CID: 4984872 IUPAC-Name: Azido(tributyl)stannan SMILES: CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-]

  spinner