Furopyrans

Wortmannin, 98 %, ACROS Organics™

Wortmannin, 98 %, ACROS Organics™

CAS: 19545-26-7 Summenformel: C23H24O8 Molekulargewicht (g/mol): 428.44 MDL-Nummer: MFCD00133927 InChI-Schlüssel: QDLHCMPXEPAAMD-QAIWCSMKSA-N Synonym: wortmannin, wartmannin, antibiotic sl-2052, unii-xva4o219qw, xva4o219qw, pi 3-kinase inhibitor, 1alpha,11alpha-11-acetyloxy-1-methoxymethyl-2-oxaandrosta-5,8-dieno 6,5,4-bc furan-3,7,17-trione, 1r,3r,5s,9r,18s-18-methoxymethyl-1,5-dimethyl-6,11,16-trioxo-13,17-dioxapentacyclo 10.6.1.0^ 2,10 .0^ 5,9 .0^ 15,19 nonadeca-2 10 ,12 19 ,14-trien-3-yl acetate, 1s,6br,9as,11r,11br-9a,11b-dimethyl-1-methyloxy methyl-3,6,9-trioxo-1,6,6b,7,8,9,9a,10,11,11b-decahydro-3h-furo 4,3,2-de indeno 4,5-h isochromen-11-yl acetate, wortmanin PubChem CID: 312145 ChEBI: CHEBI:52289 IUPAC-Name: (1R,3R,5S,9R,18S)-18-(Methoxymethyl)-1,5-dimethyl-6,11,16-trioxo-13,17-dioxapentacyclo[10.6.1.0²,¹⁰.0⁵,⁹.0¹⁵,¹⁹]nonadeca-2(10),12(19),14-trien-3-ylacetat SMILES: COC[C@H]1OC(=O)C2=COC3=C2[C@@]1(C)C1=C([C@@H]2CCC(=O)[C@@]2(C)C[C@H]1OC(C)=O)C3=O

  spinner