Benzoyl peroxides

Dibenzoylperoxid, 75 %, Restwasser, ACROS Organics™

Dibenzoylperoxid, 75 %, Restwasser, ACROS Organics™

CAS: 94-36-0 Summenformel: C14H10O4 Molekulargewicht (g/mol): 242.23 MDL-Nummer: MFCD00003071 InChI-Schlüssel: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC-Name: Benzoylbenzolcarboperoxoat SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2

Alfa Aesar™ Benzoylperoxid, 97 % (Trockengewicht), nass mit 25 % Wasser

Alfa Aesar™ Benzoylperoxid, 97 % (Trockengewicht), nass mit 25 % Wasser

CAS: 94-36-0 Summenformel: C14H10O4 Molekulargewicht (g/mol): 242.23 MDL-Nummer: MFCD00003071 InChI-Schlüssel: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide, dibenzoyl peroxide, peroxide, dibenzoyl, benzoperoxide, benzoyl superoxide, acetoxyl, lucidol, benoxyl, panoxyl, benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC-Name: Benzoylbenzolcarboperoxoat SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2

  spinner