Chrysenes

Benzo[a]pyrol, 96 %, Alfa Aesar™

Benzo[a]pyrol, 96 %, Alfa Aesar™

CAS: 50-32-8 Summenformel: C20H12 Molekulargewicht (g/mol): 252.32 MDL-Nummer: MFCD00003602 InChI-Schlüssel: FMMWHPNWAFZXNH-UHFFFAOYSA-N Synonym: benzo a pyrene, 3,4-benzopyrene, benzo pqr tetraphene, 3,4-benzpyrene, benzpyrene, benzo def chrysene, 6,7-benzopyrene, benz a pyrene, 3,4-benz a pyrene PubChem CID: 2336 ChEBI: CHEBI:29865 IUPAC-Name: pentacyclo[10.6.2.0²,⁷.0⁹,¹⁹.0¹⁶,²⁰]icosa-1(18),2,4,6,8,10,12,14,16,19-decaene SMILES: C1=CC=C2C(=C1)C=C1C=CC3=CC=CC4=CC=C2C1=C34

  spinner