Pyrroloindoles

Alfa Aesar™ Staurosporin, 99+ %

Alfa Aesar™ Staurosporin, 99+ %

CAS: 62996-74-1 Summenformel: C28H26N4O3 Molekulargewicht (g/mol): 466.541 MDL-Nummer: MFCD00077402 InChI-Schlüssel: HKSZLNNOFSGOKW-ZYSRIHRCSA-N Synonym: Antibiotic AM-2282 PubChem CID: 49831000 SMILES: CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC

Staurosporin, 98 %, ACROS Organics™

Staurosporin, 98 %, ACROS Organics™

CAS: 62996-74-1 Summenformel: C28H26N4O3 Molekulargewicht (g/mol): 466.5 MDL-Nummer: MFCD00077402 InChI-Schlüssel: HKSZLNNOFSGOKW-ZYSRIHRCSA-N Synonym: staurosporine, kinome_3629 PubChem CID: 49831000 SMILES: CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC

K-252a, 98 %, ACROS Organics™

K-252a, 98 %, ACROS Organics™

CAS: 97161-97-2 Summenformel: C27H21N3O5 Molekulargewicht (g/mol): 467.5 MDL-Nummer: MFCD00161522 InChI-Schlüssel: KOZFSFOOLUUIGY-UHFFFAOYSA-N Synonym: methyl 6-hydroxy-5-methyl-13-oxo-5,6,7,8,14,15-hexahydro-13h-5,8-epoxy-4b,8a,14-triazadibenzo b,h cycloocta 1,2,3,4-jkl cyclopenta e-as-indacene-6-carboxylate PubChem CID: 3813 SMILES: CC12C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)OC)O

Staurosporin, MP Biomedicals™

Staurosporin, MP Biomedicals™

CAS: 62996-74-1 Summenformel: C28H26N4O3 Molekulargewicht (g/mol): 466.541 InChI-Schlüssel: HKSZLNNOFSGOKW-ZYSRIHRCSA-N Synonym: Staurosporin, Antibiotikum AM-2282 PubChem CID: 49831000 SMILES: CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC

  spinner