Mercuribenzoic acids

4-(Hydroxymercuri)benzoesäure-Natriumsalz, 98 %, ACROS Organics™

4-(Hydroxymercuri)benzoesäure-Natriumsalz, 98 %, ACROS Organics™

CAS: 138-85-2 Summenformel: C7H5HgNaO3 Molekulargewicht (g/mol): 360.69 MDL-Nummer: MFCD00002527 InChI-Schlüssel: BERBQUNVJGVZCX-UHFFFAOYSA-M Synonym: sodium 4-carboxylatophenyl mercury hydrate, sodium hydrate p-mercuribenzoate PubChem CID: 23667696 IUPAC-Name: Natrium;(4-carboxylatophenyl)mercury;hydrat SMILES: C1=CC(=CC=C1C(=O)[O-])[Hg].O.[Na+]

  spinner