Aryl phosphodiesters

Diphenylphosphat, 97%, Thermo Scientific™

Diphenylphosphat, 97%, Thermo Scientific™

CAS: 838-85-7 Summenformel: C12H11O4P Molekulargewicht (g/mol): 250.19 MDL-Nummer: MFCD00003033 InChI-Schlüssel: ASMQGLCHMVWBQR-UHFFFAOYSA-N Synonym: diphenyl phosphate, phosphoric acid, diphenyl ester, phenyl hydrogen phosphate, phenyl phosphate pho 2 ho po, diphenoxyphosphinic acid, phosphoric acid diphenyl ester, diphenylphosphoric acid, phosphoric acid diphenyl, dsstox_cid_28182 PubChem CID: 13282 IUPAC-Name: diphenoxyphosphinic acid SMILES: OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1

1,1'-Binaphthyl-2,2 '-Diylhydrogenphosphat, 99 %, Thermo Scientific™

1,1'-Binaphthyl-2,2 '-Diylhydrogenphosphat, 99 %, Thermo Scientific™

CAS: 35193-63-6 Summenformel: C20H13O4P Molekulargewicht (g/mol): 348.294 MDL-Nummer: MFCD00010045 InChI-Schlüssel: JEHUZVBIUCAMRZ-UHFFFAOYSA-N Synonym: 1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, s-+-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, r---1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, 1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r---bnp acid, 11bs-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, r---1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, s-+-bnp acid, 4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide PubChem CID: 99589 SMILES: C1=CC=C2C(=C1)C=CC3=C2C4=C(C=CC5=CC=CC=C54)OP(=O)(O3)O

(S)-(+)-1,1 '-Binaphthyl-2,2 '-Diylhydrogenphosphat,98 + %, Thermo Scientific™

(S)-(+)-1,1 '-Binaphthyl-2,2 '-Diylhydrogenphosphat,98 + %, Thermo Scientific™

CAS: 35193-64-7 Summenformel: C20H13O4P Molekulargewicht (g/mol): 348.294 MDL-Nummer: MFCD00010045 InChI-Schlüssel: JEHUZVBIUCAMRZ-UHFFFAOYSA-N Synonym: 1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, s-+-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, r---1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, 1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r---bnp acid, 11bs-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, r---1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, s-+-bnp acid, 4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide PubChem CID: 99589 SMILES: C1=CC=C2C(=C1)C=CC3=C2C4=C(C=CC5=CC=CC=C54)OP(=O)(O3)O

(R)-(-)-1,1'-Binaphthyl-2,2'-Diylhydrogenphosphat, 98 +%, Thermo Scientific™

(R)-(-)-1,1'-Binaphthyl-2,2'-Diylhydrogenphosphat, 98 +%, Thermo Scientific™

CAS: 39648-67-4 Summenformel: C20H12O4P Molekulargewicht (g/mol): 347.29 MDL-Nummer: MFCD00010045 InChI-Schlüssel: JEHUZVBIUCAMRZ-UHFFFAOYSA-M Synonym: 1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, s-+-1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, r---1,1'-binaphthyl-2,2'-diyl hydrogenphosphate, 1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r---bnp acid, 11bs-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, r---1,1'-binaphthyl-2,2'-diyl hydrogen phosphate, r-4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide, s-+-bnp acid, 4-hydroxydinaphtho 2,1-d:1',2'-f 1,3,2 dioxaphosphepine 4-oxide PubChem CID: 99589 IUPAC-Name: 13-Oxo-12,14-dioxa-13λ⁵-phosphapentacyclo[²,¹¹.0³,⁸.0¹⁸,²³]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaen-13-olat SMILES: [O-]P1(=O)OC2=CC=C3C=CC=CC3=C2C2=C3C=CC=CC3=CC=C2O1

Diphenylphosphat, 99 %, Thermo Scientific™

Diphenylphosphat, 99 %, Thermo Scientific™

CAS: 838-85-7 Summenformel: C12H11O4P Molekulargewicht (g/mol): 250.19 MDL-Nummer: MFCD00003033 InChI-Schlüssel: ASMQGLCHMVWBQR-UHFFFAOYSA-N Synonym: diphenyl phosphate, phosphoric acid, diphenyl ester, phenyl hydrogen phosphate, phenyl phosphate pho 2 ho po, diphenoxyphosphinic acid, phosphoric acid diphenyl ester, diphenylphosphoric acid, phosphoric acid diphenyl, dsstox_cid_28182 PubChem CID: 13282 IUPAC-Name: diphenoxyphosphinic acid SMILES: OP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1
