Camphoric Acid

D(+)-Camphersäure, 99 %, ACROS Organics™

D(+)-Camphersäure, 99 %, ACROS Organics™

CAS: 124-83-4 Summenformel: C10H14O4-2 Molekulargewicht (g/mol): 198.218 MDL-Nummer: MFCD00001375 InChI-Schlüssel: LSPHULWDVZXLIL-LDWIPMOCSA-L Synonym: d-+-camphoric acid, 1r,3s-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid, d-camphoric acid, 1r,3s-+-camphoric acid, unii-w77rm1csd5, camphoric acid, 1,3-cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, 1r,3s, w77rm1csd5, 1,2,2-trimethyl-1,3-cyclopentanedicarboxylic acid, 1r-cis, 1r,3s-camphoric acid PubChem CID: 6918944 IUPAC-Name: (1R,3S)-1,2,2-Trimethylcyclopentan-1,3-Dicarboxylate SMILES: CC1(C(CCC1(C)C(=O)[O-])C(=O)[O-])C
