Humic Acid

Huminsäure, Natriumsalz, 45 – 70 %, ACROS Organics™

CAS: 68131-04-4 Summenformel: C9H8Na2O4 Molekulargewicht (g/mol): 226.139 MDL-Nummer: MFCD00135560 InChI-Schlüssel: HMGUIQPKFUZDPV-UHFFFAOYSA-L Synonym: humic acid sodium salt, sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate, sodium humate, disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate, disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate, bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt PubChem CID: 21908873 IUPAC-Name: Dinatriumhydrolyse, Bicyclo[2.2.1]hept-5-en-2,3-Dicarboxylat SMILES: C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+]

Huminsäure-Natriumsalz, tech. 50-60 % (als Huminsäure), Alfa Aesar™

CAS: 68131-04-4 Summenformel: C9H8Na2O4 Molekulargewicht (g/mol): 226.139 MDL-Nummer: MFCD00135560 InChI-Schlüssel: HMGUIQPKFUZDPV-UHFFFAOYSA-L Synonym: humic acid sodium salt, sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate, sodium humate, disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate, disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate, bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt PubChem CID: 21908873 IUPAC-Name: Dinatriumhydrolyse, Bicyclo[2.2.1]hept-5-en-2,3-Dicarboxylat SMILES: C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+]

Huminsäure, Alfa Aesar™

CAS: 1415-93-6 MDL-Nummer: MFCD00147177
