Pamoic Acid

Pamosäure, 99 %, Alfa Aesar™

CAS: 130-85-8 Summenformel: C23H16O6 Molekulargewicht (g/mol): 388.375 MDL-Nummer: MFCD00004079 InChI-Schlüssel: WLJNZVDCPSBLRP-UHFFFAOYSA-N Synonym: pamoic acid, embonic acid, 4,4'-methylenebis 3-hydroxy-2-naphthoic acid, pamosaeure, unii-7rrq8qz38n, 2-naphthalenecarboxylic acid, 4,4'-methylenebis 3-hydroxy, 7rrq8qz38n, pamoic acid 98+% hplc, 4,4'-methylen-bis-3-hydroxy-2-naphthoesaeure PubChem CID: 8546 ChEBI: CHEBI:50186 IUPAC-Name: 4-[(3-Carboxy-2-Hydroxynaphthalin-1-yl)Methyl]-3-Hydroxynaphthalin-2-Carbonsäure SMILES: C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O

Pamoinsäure, 98+ %, ACROS Organics™

CAS: 130-85-8 Summenformel: C23H16O6 Molekulargewicht (g/mol): 388.375 MDL-Nummer: MFCD00004079 InChI-Schlüssel: WLJNZVDCPSBLRP-UHFFFAOYSA-N Synonym: pamoic acid, embonic acid, 4,4'-methylenebis 3-hydroxy-2-naphthoic acid, pamosaeure, unii-7rrq8qz38n, 2-naphthalenecarboxylic acid, 4,4'-methylenebis 3-hydroxy, 7rrq8qz38n, pamoic acid 98+% hplc, 4,4'-methylen-bis-3-hydroxy-2-naphthoesaeure PubChem CID: 8546 ChEBI: CHEBI:50186 IUPAC-Name: 4-[(3-Carboxy-2-Hydroxynaphthalin-1-yl)Methyl]-3-Hydroxynaphthalin-2-Carbonsäure SMILES: C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O
