p-Toluenesulfonic Acid

p-Toluolsulfonsäure-Monohydrat, 99 %, extra-rein, ACROS Organics™

CAS: 6192-52-5 Summenformel: C7H10O4S Molare Masse (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem-CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

p-Toluolsulfonsäure, Monohydrat, Acros Organics™

CAS: 6192-52-5 Summenformel: C7H10O4S Molare Masse (g/mol): 190.213 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem-CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

P-Toluensulfonsäure-Monohydrat, 97 %, Alfa Aesar™

CAS: 6192-52-5 Summenformel: C7H10O4S Molare Masse (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem-CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

Alfa Aesar™ p-Toluolsulfonsäure-Monohydrat, ACS, 98.5+%

CAS: 6192-52-5 Summenformel: C7H10O4S Molare Masse (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem-CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

Alfa Aesar™ p-Toluolsulfonsäure, Natriumsalz, 90+%

CAS: 657-84-1 Summenformel: C7H7NaO3S Molare Masse (g/mol): 194.18 MDL-Nummer: MFCD00798566 InChI-Schlüssel: KVCGISUBCHHTDD-UHFFFAOYSA-M Synonym: sodium p-toluenesulfonate, sodium 4-methylbenzenesulfonate, sodium tosylate, p-toluenesulfonic acid sodium salt, sodium toluenesulfonate, sodium toluenesulphonate, tosylate, sodium, naxonate hydrotrope, cyclophil sts 70, eltesol st 34 PubChem-CID: 3720192 IUPAC-Name: Natrium;4-Methylbenzolsulfonat SMILES: CC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]

Alfa Aesar™ p-Toluolsulfonsäure-Monohydrat, 98 %

CAS: 6192-52-5 Summenformel: C7H10O4S Molare Masse (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem-CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

1-(p-Toluensulfonyl)-3 -nitro-1,2,4-triazol, 98 %, ACROS Organics™

CAS: 77451-51-5 Summenformel: C9H8N4O4S Molare Masse (g/mol): 268.247 InChI-Schlüssel: ZQMJAWSQRGYFBM-UHFFFAOYSA-N Synonym: 3-nitro-1-tosyl-1h-1,2,4-triazole, 1-p-toluenesulfonyl-3-nitro-1,2,4-triazole, 1-4-toluenesulfonyl-3-nitro-1,2,4-triazole, 1-4-methylphenyl sulfonyl-3-nitro-1,2,4-triazole, 1-4-methylbenzenesulfonyl-3-nitro-1,2,4-triazole, tsnt, 3-nitro-1-tosyl-1,2,4-triazole, 1-p-toluenesulfonyl-3-nitro-1,2,4-triazol, 3-nitro-1-p-tolylsulfonyl-1,2,4-triazole, 3-nitro-1-p-toluenesulfonyl-1,2,4-triazole PubChem-CID: 688072 IUPAC-Name: 1-(4-Methylphenyl)Sulfonyl-3-Nitro-1,2,4-Triazol SMILES: CC1=CC=C(C=C1)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-]

  spinner