p-Toluenesulfonic Acid

p-Toluolsulfonsäure-Monohydrat, 99 %, extra-rein, ACROS Organics™

p-Toluolsulfonsäure-Monohydrat, 99 %, extra-rein, ACROS Organics™

CAS: 6192-52-5 Summenformel: C7H10O4S Molekulargewicht (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

p-Toluolsulfonsäure, Monohydrat, Acros Organics™

p-Toluolsulfonsäure, Monohydrat, Acros Organics™

CAS: 6192-52-5 Summenformel: C7H10O4S Molekulargewicht (g/mol): 190.213 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

p-Toluolsulfonsäure-Monohydrat, ACS, 98.5+%

p-Toluolsulfonsäure-Monohydrat, ACS, 98.5+%

CAS: 6192-52-5 Summenformel: C7H10O4S Molekulargewicht (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

P-Toluensulfonsäure-Monohydrat, 97 %, Alfa Aesar™

P-Toluensulfonsäure-Monohydrat, 97 %, Alfa Aesar™

CAS: 6192-52-5 Summenformel: C7H10O4S Molekulargewicht (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

p-Toluolsulfonsäure, Natriumsalz, 90+%

p-Toluolsulfonsäure, Natriumsalz, 90+%

CAS: 657-84-1 Summenformel: C7H7NaO3S Molekulargewicht (g/mol): 194.18 MDL-Nummer: MFCD00798566,MFCD00064388 InChI-Schlüssel: KVCGISUBCHHTDD-UHFFFAOYSA-M Synonym: sodium p-toluenesulfonate, sodium 4-methylbenzenesulfonate, sodium tosylate, p-toluenesulfonic acid sodium salt, sodium toluenesulfonate, sodium toluenesulphonate, tosylate, sodium, naxonate hydrotrope, cyclophil sts 70, eltesol st 34 PubChem CID: 3720192 IUPAC-Name: Natrium;4-Methylbenzolsulfonat SMILES: [Na+].CC1=CC=C(C=C1)S([O-])(=O)=O

p-Toluolsulfonsäure-Monohydrat, 98 %

p-Toluolsulfonsäure-Monohydrat, 98 %

CAS: 6192-52-5 Summenformel: C7H10O4S Molekulargewicht (g/mol): 190.213 MDL-Nummer: MFCD00142137 InChI-Schlüssel: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC-Name: 4-DimethylBenzolsulfonsäure;Hydrat SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O

  spinner