Learn More
Aminophylline, anhydrous, 98%, Thermo Scientific™
A non-selective phosphodiesterase inhibitor
Marke: Thermo Scientific Alfa Aesar J60705.22
| Menge | 100g |
|---|
Weitere Artikel aus diesem Sortiment
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water. Insoluble in alcohol and ether.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Recommended storage temperature: -20°C. Keep away fom strong oxidizing agents.
Chemische Identifikatoren
| 317-34-0 | |
| 420.434 | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 9433 | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N |
| C16H24N10O4 | |
| MFCD00013221 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine |
Spezifikation
| Aminophylline | |
| 317-34-0 | |
| MFCD00013221 | |
| UN2811 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine | |
| 9433 | |
| 98% |
| anhydrous | |
| C16H24N10O4 | |
| 100g | |
| 14,465 | |
| Soluble in water. Insoluble in alcohol and ether. | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N | |
| 420.434 | |
| 210.21 |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.