Learn More
Irinotecan hydrochloride, Thermo Scientific™
Topoisomerase I inhibitor
Marke: Thermo Scientific Alfa Aesar J60743.MD
| Menge | 250mg |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 100286-90-6 | |
| 623.15 | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| 74990 | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride |
| C33H39ClN4O6 | |
| MFCD01862255 | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| CHEBI:5971 | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O |
Spezifikation
| Irinotecan hydrochloride | |
| C33H39ClN4O6 | |
| 250mg | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride | |
| 74990 | |
| 623.14 |
| 100286-90-6 | |
| MFCD01862255 | |
| 14,5091 | |
| Soluble in DMSO or DMF at approximately 20mg/ml; Sparingly soluble in aqueous buffers; /n | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O | |
| 623.15 | |
| CHEBI:5971 |
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.