Learn More
Puerarin, 98%, Thermo Scientific™
Marke: Thermo Scientific Alfa Aesar J66528.09
| Menge | 10g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- Thought to interfere with the synthesis of mycolic acids, an essential fatty acid component found in Mycobacterium cell walls
Chemische Identifikatoren
| 3681-99-0 | |
| 416.38 | |
| HKEAFJYKMMKDOR-VPRICQMDSA-N | |
| 53384442 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC=C(C(=O)C2=CC=C1O)C1=CC=C(O)C=C1 |
| C21H20O9 | |
| MFCD00063399 | |
| 8-beta-d-glucopyranosyl-4',7-dihydroxyisoflavone | |
| 7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one |
Spezifikation
| Puerarin | |
| C21H20O9 | |
| 10g | |
| 8-beta-d-glucopyranosyl-4',7-dihydroxyisoflavone | |
| HKEAFJYKMMKDOR-VPRICQMDSA-N | |
| 7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one | |
| 53384442 | |
| 98% |
| 3681-99-0 | |
| MFCD00063399 | |
| 64198 | |
| Soluble in DMSO or DMF; Slightly soluble in water or ethanol | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC=C(C(=O)C2=CC=C1O)C1=CC=C(O)C=C1 | |
| 416.38 | |
| 416.38 |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.