
Ascarit(II), CO2-Absorptionsmittel, 20 bis 30 Mesh, Kapazität: 40–50 %, Thermo Scientific Chemicals

Ascarit(II), CO2-Absorptionsmittel, 20 bis 30 Mesh, Kapazität: 40–50 %, Thermo Scientific Chemicals

Ascarit(II), CO2-Absorptionsmittel, 20-30 Mesh, Fassungsvermögen:40-50 %, CAS-Nummer 81133-20-2, 1310-73-2, 7631-86-9, 100 g, beige bis braun, Gefahr, GHS H-Satz:Verursacht schwere Verätzungen der Haut und schwere Augenschäden

2,4-Dinitrobenzolsulfonsäure-Natriumsalz, 97 %, Thermo Scientific Chemicals

2,4-Dinitrobenzolsulfonsäure-Natriumsalz, 97 %, Thermo Scientific Chemicals

CAS: 885-62-1 Summenformel: C6H3N2NaO7S Molekulargewicht (g/mol): 270.15 MDL-Nummer: MFCD00007471,MFCD10567393 InChI-Schlüssel: GSBYVRKLPCSLNV-UHFFFAOYSA-M Synonym: 2,4-dinitrobenzenesulfonic acid sodium salt hydrate, sodium dnbs hydrate, acmc-209quh, sodium 2,4-dinitrobenzenesulfonate hydrate PubChem CID: 70700115 IUPAC-Name: sodium 2,4-dinitrobenzene-1-sulfonate SMILES: [Na+].[O-][N+](=O)C1=CC=C(C(=C1)[N+]([O-])=O)S([O-])(=O)=O

2,4-Dinitrobenzenesulfonsäure-Hydrat, 98 %, Thermo Scientific Chemicals

2,4-Dinitrobenzenesulfonsäure-Hydrat, 98 %, Thermo Scientific Chemicals

CAS: 698999-22-3 Summenformel: C6H6N2O8S Molekulargewicht (g/mol): 266.18 MDL-Nummer: MFCD00150961 InChI-Schlüssel: GWGBNENHEGYJSN-UHFFFAOYSA-N Synonym: c6h4n2o7s.h2o, dinitrobenzenesulfonic acid hydrate, 2,4-dinitrobenzenesulfonic acid hydrate PubChem CID: 16217154 IUPAC-Name: 2,4-dinitrobenzolsulfonsäure;hydrat SMILES: C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)O.O
