p-Nitrobenzenesulfonates

Ascarit(II), CO2-Absorptionsmittel, 20 bis 30 Mesh, Kapazität: 40–50 %, ACROS Organics™

Ascarit(II), CO2-Absorptionsmittel, 20 bis 30 Mesh, Kapazität: 40–50 %, ACROS Organics™

Ascarite(II), CO2 absorbent, 20-30 mesh, capacity: 40-50%, CAS Number-81133-20-2, 1310-73-2, 7631-86-9, 100g, Beige to Brown, Danger, GHS H Statement: Causes severe skin burns and eye damage.

Alfa Aesar™ 2,4-Dinitrobenzolsulfonsäure-Natriumsalz, 97 %

Alfa Aesar™ 2,4-Dinitrobenzolsulfonsäure-Natriumsalz, 97 %

CAS: 885-62-1 Summenformel: C6H3N2NaO7S Molekulargewicht (g/mol): 270.15 MDL-Nummer: MFCD00007471,MFCD10567393 InChI-Schlüssel: GSBYVRKLPCSLNV-UHFFFAOYSA-M Synonym: sodium 2,4-dinitrobenzenesulfonate hydrate, acmc-209quh, sodium dnbs hydrate, 2,4-dinitrobenzenesulfonic acid sodium salt hydrate PubChem CID: 70700115 IUPAC-Name: sodium 2,4-dinitrobenzene-1-sulfonate SMILES: [Na+].[O-][N+](=O)C1=CC=C(C(=C1)[N+]([O-])=O)S([O-])(=O)=O

Alfa Aesar™ 2,4-Dinitrobenzenesulfonsäure-Hydrat, 98 %

Alfa Aesar™ 2,4-Dinitrobenzenesulfonsäure-Hydrat, 98 %

CAS: 698999-22-3 Summenformel: C6H6N2O8S Molekulargewicht (g/mol): 266.18 MDL-Nummer: MFCD00150961 InChI-Schlüssel: GWGBNENHEGYJSN-UHFFFAOYSA-N Synonym: 2,4-dinitrobenzenesulfonic acid hydrate, dinitrobenzenesulfonic acid hydrate, c6h4n2o7s.h2o PubChem CID: 16217154 IUPAC-Name: 2,4-dinitrobenzolsulfonsäure;hydrat SMILES: C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)O.O

  spinner