Toluene diisocyanates

Tolylol-2,4-diisocyanat, 80 %, tech., Thermo Scientific™™

Tolylol-2,4-diisocyanat, 80 %, tech., Thermo Scientific™™

CAS: 584-84-9 Summenformel: C9H6N2O2 Molekulargewicht (g/mol): 174.16 InChI-Schlüssel: DVKJHBMWWAPEIU-UHFFFAOYSA-N Synonym: 2,4-toluene diisocyanate, 2,4-diisocyanatotoluene, tolylene-2,4-diisocyanate, toluene-2,4-diisocyanate, 2,4-tolylene diisocyanate, toluene 2,4-diisocyanate, 4-methyl-m-phenylene diisocyanate, tolylene diisocyanate, 2,4-tdi, toluylene-2,4-diisocyanate PubChem CID: 11443 ChEBI: CHEBI:53556 IUPAC-Name: 2,4-Diisocyanat-1-Methylbenzol SMILES: CC1=C(C=C(C=C1)N=C=O)N=C=O

Toluol-2,6-diisocyanat, 97 %, Thermo Scientific™

Toluol-2,6-diisocyanat, 97 %, Thermo Scientific™

CAS: 91-08-7 Summenformel: C9H6N2O2 Molekulargewicht (g/mol): 174.159 MDL-Nummer: MFCD00002010 InChI-Schlüssel: RUELTTOHQODFPA-UHFFFAOYSA-N Synonym: 2,6-diisocyanatotoluene, toluene-2,6-diisocyanate, 2,6-toluene diisocyanate, 2-methyl-m-phenylene diisocyanate, 2,6-tdi, m-tolylene diisocyanate, meta-tolylene diisocyanate, toluene 2,6-diisocyanate, benzene, 1,3-diisocyanato-2-methyl, 2,6-diisocyanato-1-methylbenzene PubChem CID: 7040 ChEBI: CHEBI:53557 IUPAC-Name: 1,3-Diisocyanat-2-Methylbenzol SMILES: CC1=C(C=CC=C1N=C=O)N=C=O

Tolylol 2,6-diisocyanat, 97 %, Thermo Scientific™

Tolylol 2,6-diisocyanat, 97 %, Thermo Scientific™

CAS: 91-08-7 Summenformel: C9H6N2O2 Molekulargewicht (g/mol): 174.16 MDL-Nummer: MFCD00002010 InChI-Schlüssel: RUELTTOHQODFPA-UHFFFAOYSA-N Synonym: 2,6-diisocyanatotoluene, toluene-2,6-diisocyanate, 2,6-toluene diisocyanate, 2-methyl-m-phenylene diisocyanate, 2,6-tdi, m-tolylene diisocyanate, meta-tolylene diisocyanate, toluene 2,6-diisocyanate, benzene, 1,3-diisocyanato-2-methyl, 2,6-diisocyanato-1-methylbenzene PubChem CID: 7040 ChEBI: CHEBI:53557 IUPAC-Name: 1,3-Diisocyanat-2-Methylbenzol SMILES: CC1=C(C=CC=C1N=C=O)N=C=O

Toluol-2,4-Diisocyanat, Tech. 80 %, Rest-2,6-Diisocyanat, Thermo Scientific™

Toluol-2,4-Diisocyanat, Tech. 80 %, Rest-2,6-Diisocyanat, Thermo Scientific™

CAS: 584-84-9 Summenformel: C9H6N2O2 Molekulargewicht (g/mol): 174.159 MDL-Nummer: MFCD00002011 InChI-Schlüssel: DVKJHBMWWAPEIU-UHFFFAOYSA-N Synonym: 2,4-toluene diisocyanate, 2,4-diisocyanatotoluene, tolylene-2,4-diisocyanate, toluene-2,4-diisocyanate, 2,4-tolylene diisocyanate, toluene 2,4-diisocyanate, 4-methyl-m-phenylene diisocyanate, tolylene diisocyanate, 2,4-tdi, toluylene-2,4-diisocyanate PubChem CID: 11443 ChEBI: CHEBI:53556 IUPAC-Name: 2,4-Diisocyanat-1-Methylbenzol SMILES: CC1=C(C=C(C=C1)N=C=O)N=C=O
