Learn More
Pirenzepine dihydrochloride, 99%, Thermo Scientific™
A M1 muscarinic receptor antagonist
Marke: Thermo Scientific Alfa Aesar J62252.03
| Menge | 1g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 29868-97-1 | |
| 424.326 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 71405 | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride |
| C19H23Cl2N5O2 | |
| MFCD00055214 | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CHEBI:32014 | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl |
Spezifikation
| Pirenzepine dihydrochloride | |
| C19H23Cl2N5O2 | |
| 1g | |
| 14,7491 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride | |
| 71405 | |
| 424.32 |
| 29868-97-1 | |
| MFCD00055214 | |
| Hygroscopic | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl | |
| 424.326 | |
| CHEBI:32014 | |
| 99% |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.