Dioxane
- (2)
- (3)
- (3)
- (2)
- (2)
- (3)
- (3)
- (3)
- (3)
- (3)
- (2)
- (2)
- (2)
- (4)
- (1)
- (3)
- (2)
- (1)
- (2)
- (3)
- (1)
- (2)
- (1)
- (2)
- (2)
- (2)
- (10)
- (5)
- (3)
- (1)
- (2)
- (1)
- (1)
- (7)
- (1)
- (1)
- (2)
- (12)
- (1)
- (3)
- (1)
- (2)
- (1)
- (5)
- (3)
- (3)
- (2)
- (3)
- (17)
- (1)
- (6)
- (3)
- (7)
- (3)
- (1)
- (1)
- (7)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (2)
Gefilterte Suchergebnisse
5,5-Dimethyl-1,3-dioxan-2-on, tech., Thermo Scientific Chemicals
CAS: 3592-12-9 Summenformel: C6H10O3 Molekulargewicht (g/mol): 130.14 MDL-Nummer: MFCD00014650 InChI-Schlüssel: JRFXQKZEGILCCO-UHFFFAOYSA-N Synonym: neopentylene carbonate,2,2-dimethyltrimethylene carbonate,5,5-dimethyl-1,3-diox-2-one,acmc-1adx1,3-nitro-5-chlorobenzenesulfonamide,5,5-dimethyltrimethylene carbonate,5,5-dimethyl-1,3-dioxane-2-one,5,5-dimethyl-2-oxo-1,3-dioxane,1,3-dioxan-2-one,5,5-dimethyl,5,5-dimethyl-1,3 dioxan-2-one PubChem CID: 137984 IUPAC-Name: 5,5-Dimethyl-1,3-Dioxan-2-on SMILES: CC1(COC(=O)OC1)C
| InChI-Schlüssel | JRFXQKZEGILCCO-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 5,5-Dimethyl-1,3-Dioxan-2-on |
| PubChem CID | 137984 |
| CAS | 3592-12-9 |
| MDL-Nummer | MFCD00014650 |
| Molekulargewicht (g/mol) | 130.14 |
| SMILES | CC1(COC(=O)OC1)C |
| Synonym | neopentylene carbonate,2,2-dimethyltrimethylene carbonate,5,5-dimethyl-1,3-diox-2-one,acmc-1adx1,3-nitro-5-chlorobenzenesulfonamide,5,5-dimethyltrimethylene carbonate,5,5-dimethyl-1,3-dioxane-2-one,5,5-dimethyl-2-oxo-1,3-dioxane,1,3-dioxan-2-one,5,5-dimethyl,5,5-dimethyl-1,3 dioxan-2-one |
| Summenformel | C6H10O3 |
1,3-Dioxan, 98 %, Thermo Scientific Chemicals
CAS: 505-22-6 Summenformel: C4H8O2 Molekulargewicht (g/mol): 88.106 MDL-Nummer: MFCD00006566 InChI-Schlüssel: VDFVNEFVBPFDSB-UHFFFAOYSA-N Synonym: m-dioxane,1,3-dioxacyclohexane,meta-dioxane,1,3-propanediol formal,m-dioxin, dihydro,trimethylene glycol methylene ether,dihydro-m-dioxin,unii-b2c8m17i09,ccris 5911,2,4-dioxane PubChem CID: 10450 ChEBI: CHEBI:46924 IUPAC-Name: 1,3-Dioxan SMILES: C1COCOC1
| InChI-Schlüssel | VDFVNEFVBPFDSB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dioxan |
| PubChem CID | 10450 |
| CAS | 505-22-6 |
| ChEBI | CHEBI:46924 |
| MDL-Nummer | MFCD00006566 |
| Molekulargewicht (g/mol) | 88.106 |
| SMILES | C1COCOC1 |
| Synonym | m-dioxane,1,3-dioxacyclohexane,meta-dioxane,1,3-propanediol formal,m-dioxin, dihydro,trimethylene glycol methylene ether,dihydro-m-dioxin,unii-b2c8m17i09,ccris 5911,2,4-dioxane |
| Summenformel | C4H8O2 |
Glycerolformal, 99 %, Isomerengemisch, stabilisiert, Thermo Scientific Chemicals
CAS: 4740-78-7 | C4H8O3 | 104.11 g/mol
| Chemischer Name oder Material | Glycerol formal |
|---|---|
| Siedepunkt | 193.0°C to 195.0°C |
| Dichte | 1.2100g/mL |
| Viskosität | 16 mPa.s (20°C) |
| Verpackung | Glasflasche |
| EINECS-Nummer | 225-248-9 |
| Relative Dichte | 1.21 |
| Molekulargewicht (g/mol) | 104.11 |
| Merck Index | 14, 4485 |
| Namenshinweis | 99+% |
| Infrarotspektrum | Echt |
| Formelmasse | 104.11 |
| Gesundheitsgefahr 2 | GHS-H-Satz Verursacht schwere Augenreizung. Kann die Fruchtbarkeit beeinträchtigen oder das Kind im Mutterleib schädigen. |
| Gesundheitsgefahr 3 | GHS-P-Hinweis BEI KONTAKT MIT DEN AUGEN:Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. Schutzhandschuhe/Schutzkleidung/Augenschutz/Gesichtsschutz tragen. BEI Exposition oder falls betroffen: |
| Löslichkeitsinformationen | (50% in water) Clear |
| Gesundheitsgefahr 1 | GHS-Signalwort: Warnhinweis |
| Physikalische Form | Flüssigkeit |
| CAS | 5464-28-8 |
| Brechungsindex | 1.4500 to 1.4520 |
| MDL-Nummer | MFCD00003218 |
| Prozentgehaltsbereich | 99% min. Sum of alpha-and beta-isomers (GC) |
| pH | 4.0 to 6.5 (10% soln.) |
| Flammpunkt | 97°C |
| Reinheit (%) | 99+% |
| Summenformel | C4H8O3 |
5-Brom-5-nitro-1,3-dioxan, 98 %, Thermo Scientific Chemicals
CAS: 30007-47-7 Summenformel: C4H6BrNO4 Molekulargewicht (g/mol): 211.999 MDL-Nummer: MFCD00101855 InChI-Schlüssel: XVBRCOKDZVQYAY-UHFFFAOYSA-N Synonym: bronidox,1,3-dioxane, 5-bromo-5-nitro,5-bromo-5-nitro-m-dioxane,unii-u184i9qbnm,5-brom-5-nitro-1,3-dioxan,m-dioxane, 5-bromo-5-nitro,5-brom-5-nitro-1,3-dioxan german,u184i9qbnm,bronidox l,acmc-209hcf PubChem CID: 1807 IUPAC-Name: 5-Brom-5-Nitro-1,3-Dioxan SMILES: C1C(COCO1)([N+](=O)[O-])Br
| InChI-Schlüssel | XVBRCOKDZVQYAY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 5-Brom-5-Nitro-1,3-Dioxan |
| PubChem CID | 1807 |
| CAS | 30007-47-7 |
| MDL-Nummer | MFCD00101855 |
| Molekulargewicht (g/mol) | 211.999 |
| SMILES | C1C(COCO1)([N+](=O)[O-])Br |
| Synonym | bronidox,1,3-dioxane, 5-bromo-5-nitro,5-bromo-5-nitro-m-dioxane,unii-u184i9qbnm,5-brom-5-nitro-1,3-dioxan,m-dioxane, 5-bromo-5-nitro,5-brom-5-nitro-1,3-dioxan german,u184i9qbnm,bronidox l,acmc-209hcf |
| Summenformel | C4H6BrNO4 |
2,2-Dimethyl-1,3-dioxan-4,6-dion, 98 %, Thermo Scientific Chemicals
CAS: 2033-24-1 Summenformel: C6H8O4 Molekulargewicht (g/mol): 144.13 MDL-Nummer: MFCD00006638 InChI-Schlüssel: GXHFUVWIGNLZSC-UHFFFAOYSA-N Synonym: meldrum's acid,isopropylidene malonate,meldrums acid,1,3-dioxane-4,6-dione, 2,2-dimethyl,sub-isopropyl malonate,2,2-dimethyl-1,3-dioxan-4,6-dione,cycl-isopropylidene malonate,cyclic isopropylidene malonate,malonic acid cyclic isopropylidene ester,meldrum acid PubChem CID: 16249 IUPAC-Name: 2,2-Dimethyl-1,3-Dioxan-4,6-Dion SMILES: CC1(OC(=O)CC(=O)O1)C
| InChI-Schlüssel | GXHFUVWIGNLZSC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2-Dimethyl-1,3-Dioxan-4,6-Dion |
| PubChem CID | 16249 |
| CAS | 2033-24-1 |
| MDL-Nummer | MFCD00006638 |
| Molekulargewicht (g/mol) | 144.13 |
| SMILES | CC1(OC(=O)CC(=O)O1)C |
| Synonym | meldrum's acid,isopropylidene malonate,meldrums acid,1,3-dioxane-4,6-dione, 2,2-dimethyl,sub-isopropyl malonate,2,2-dimethyl-1,3-dioxan-4,6-dione,cycl-isopropylidene malonate,cyclic isopropylidene malonate,malonic acid cyclic isopropylidene ester,meldrum acid |
| Summenformel | C6H8O4 |
2-Ethyl-5,5-dimethyl-1,3-dioxan, 99 %, Thermo Scientific Chemicals
CAS: 768-58-1 Summenformel: C8H16O2 Molekulargewicht (g/mol): 144.214 MDL-Nummer: MFCD16622268 InChI-Schlüssel: QSHOOPIYPOINNH-UHFFFAOYSA-N Synonym: solution in acetonitrile 1000mg/l,1,3-dioxane, 2-ethyl-5,5-dimethyl PubChem CID: 69852 IUPAC-Name: 2-Ethyl-5,5-Dimethyl-1,3-Dioxan SMILES: CCC1OCC(CO1)(C)C
| InChI-Schlüssel | QSHOOPIYPOINNH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Ethyl-5,5-Dimethyl-1,3-Dioxan |
| PubChem CID | 69852 |
| CAS | 768-58-1 |
| MDL-Nummer | MFCD16622268 |
| Molekulargewicht (g/mol) | 144.214 |
| SMILES | CCC1OCC(CO1)(C)C |
| Synonym | solution in acetonitrile 1000mg/l,1,3-dioxane, 2-ethyl-5,5-dimethyl |
| Summenformel | C8H16O2 |
Isopropyliden-malonat, 98 %, Thermo Scientific Chemicals
CAS: 2033-24-1 Summenformel: C6H8O4 Molekulargewicht (g/mol): 144.126 MDL-Nummer: MFCD00006638 InChI-Schlüssel: GXHFUVWIGNLZSC-UHFFFAOYSA-N Synonym: meldrum's acid,isopropylidene malonate,meldrums acid,1,3-dioxane-4,6-dione, 2,2-dimethyl,sub-isopropyl malonate,2,2-dimethyl-1,3-dioxan-4,6-dione,cycl-isopropylidene malonate,cyclic isopropylidene malonate,malonic acid cyclic isopropylidene ester,meldrum acid PubChem CID: 16249 IUPAC-Name: 2,2-Dimethyl-1,3-Dioxan-4,6-Dion SMILES: CC1(OC(=O)CC(=O)O1)C
| InChI-Schlüssel | GXHFUVWIGNLZSC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2-Dimethyl-1,3-Dioxan-4,6-Dion |
| PubChem CID | 16249 |
| CAS | 2033-24-1 |
| MDL-Nummer | MFCD00006638 |
| Molekulargewicht (g/mol) | 144.126 |
| SMILES | CC1(OC(=O)CC(=O)O1)C |
| Synonym | meldrum's acid,isopropylidene malonate,meldrums acid,1,3-dioxane-4,6-dione, 2,2-dimethyl,sub-isopropyl malonate,2,2-dimethyl-1,3-dioxan-4,6-dione,cycl-isopropylidene malonate,cyclic isopropylidene malonate,malonic acid cyclic isopropylidene ester,meldrum acid |
| Summenformel | C6H8O4 |
2,2-Dimethyl-1,3-dioxan-5-on, tech. 90 %, Thermo Scientific Chemicals
CAS: 74181-34-3 Summenformel: C6H10O3 Molekulargewicht (g/mol): 130.143 MDL-Nummer: MFCD00671514 InChI-Schlüssel: ASFQDNDZFGFMMP-UHFFFAOYSA-N Synonym: 2,2-dimethyl-1,3-dioxane-5-one,2,2-dimethyl-1,3 dioxan-5-one,1,3-dioxan-5-one, 2,2-dimethyl,acmc-1bg7h,ksc496q3n,5-oxo-2,2-dimethyl-1,3-dioxane,2,2-dimethyl-1,3-dioxan-5-one, technical 250mg PubChem CID: 2733141 IUPAC-Name: 2,2-Dimethyl-1,3-Dioxan-5-on SMILES: CC1(OCC(=O)CO1)C
| InChI-Schlüssel | ASFQDNDZFGFMMP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2-Dimethyl-1,3-Dioxan-5-on |
| PubChem CID | 2733141 |
| CAS | 74181-34-3 |
| MDL-Nummer | MFCD00671514 |
| Molekulargewicht (g/mol) | 130.143 |
| SMILES | CC1(OCC(=O)CO1)C |
| Synonym | 2,2-dimethyl-1,3-dioxane-5-one,2,2-dimethyl-1,3 dioxan-5-one,1,3-dioxan-5-one, 2,2-dimethyl,acmc-1bg7h,ksc496q3n,5-oxo-2,2-dimethyl-1,3-dioxane,2,2-dimethyl-1,3-dioxan-5-one, technical 250mg |
| Summenformel | C6H10O3 |
4-Methyl-1,3-dioxan, 99 %, Thermo Scientific Chemicals
CAS: 1120-97-4 Summenformel: C5H10O2 Molekulargewicht (g/mol): 102.13 MDL-Nummer: MFCD00006569 InChI-Schlüssel: INCCMBMMWVKEGJ-UHFFFAOYSA-N Synonym: 4-methyldioxane,4-methyl-m-dioxane,1,3-dioxane, 4-methyl,m-dioxane, 4-methyl,1,3-butanediol formal,4-methyl-1,3 dioxane,acmc-2099cl,5-19-01-00054 beilstein handbook reference,4-methyl-1,3-dioxan-2-yl,m-dioxane, 4-methyl-8ci PubChem CID: 14269 IUPAC-Name: 4-Methyl-1,3-Dioxan SMILES: CC1CCOCO1
| InChI-Schlüssel | INCCMBMMWVKEGJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methyl-1,3-Dioxan |
| PubChem CID | 14269 |
| CAS | 1120-97-4 |
| MDL-Nummer | MFCD00006569 |
| Molekulargewicht (g/mol) | 102.13 |
| SMILES | CC1CCOCO1 |
| Synonym | 4-methyldioxane,4-methyl-m-dioxane,1,3-dioxane, 4-methyl,m-dioxane, 4-methyl,1,3-butanediol formal,4-methyl-1,3 dioxane,acmc-2099cl,5-19-01-00054 beilstein handbook reference,4-methyl-1,3-dioxan-2-yl,m-dioxane, 4-methyl-8ci |
| Summenformel | C5H10O2 |
3,9-Bis-(1,1-dimethyl-2-hydroxyethyl)-2,4,8,10-tetraoxaspiro-[5.5]-undecan, 97 %, Thermo Scientific Chemicals
CAS: 1455-42-1 Summenformel: C15H28O6 Molekulargewicht (g/mol): 304.383 MDL-Nummer: MFCD00059794 InChI-Schlüssel: BPZIYBJCZRUDEG-UHFFFAOYSA-N Synonym: 2,2'-2,4,8,10-tetraoxaspiro 5.5 undecane-3,9-diyl bis 2-methylpropan-1-ol,3,9-bis 1,1-dimethyl-2-hydroxyethyl-2,4,8,10-tetraoxaspiro 5.5 undecane,cyclic acetal,2-9-1-hydroxy-2-methylpropan-2-yl-2,4,8,10-tetraoxaspiro 5.5 undecan-3-yl-2-methylpropan-1-ol,acmc-209cve,ksc489m7h,2,4,8,10-tetraoxaspiro 5.5 undecane-3,9-diethanol, beta3,beta3,beta9,beta9-tetramethyl,bis hydroxypivalaldehyde pentaerythritolacetal,bis hydroxypivalaldehyde pentaerythritolacetal cyclic acetal,bis hydroxypivalaldehyde pentaerythritol acetal cyclic acetal PubChem CID: 7569008 IUPAC-Name: 2-[3-(1-Hydroxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-1-ol SMILES: CC(C)(CO)C1OCC2(CO1)COC(OC2)C(C)(C)CO
| InChI-Schlüssel | BPZIYBJCZRUDEG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-[3-(1-Hydroxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-1-ol |
| PubChem CID | 7569008 |
| CAS | 1455-42-1 |
| MDL-Nummer | MFCD00059794 |
| Molekulargewicht (g/mol) | 304.383 |
| SMILES | CC(C)(CO)C1OCC2(CO1)COC(OC2)C(C)(C)CO |
| Synonym | 2,2'-2,4,8,10-tetraoxaspiro 5.5 undecane-3,9-diyl bis 2-methylpropan-1-ol,3,9-bis 1,1-dimethyl-2-hydroxyethyl-2,4,8,10-tetraoxaspiro 5.5 undecane,cyclic acetal,2-9-1-hydroxy-2-methylpropan-2-yl-2,4,8,10-tetraoxaspiro 5.5 undecan-3-yl-2-methylpropan-1-ol,acmc-209cve,ksc489m7h,2,4,8,10-tetraoxaspiro 5.5 undecane-3,9-diethanol, beta3,beta3,beta9,beta9-tetramethyl,bis hydroxypivalaldehyde pentaerythritolacetal,bis hydroxypivalaldehyde pentaerythritolacetal cyclic acetal,bis hydroxypivalaldehyde pentaerythritol acetal cyclic acetal |
| Summenformel | C15H28O6 |
2-(2-Bromethyl)-1,3-dioxan, 98 %, Thermo Scientific Chemicals
CAS: 33884-43-4 Summenformel: C6H11BrO2 Molekulargewicht (g/mol): 195.06 MDL-Nummer: MFCD00006567 InChI-Schlüssel: KXMZOKKPQZRPRN-UHFFFAOYNA-N Synonym: 2-2-bromoethyl-1,3-dioxane,1,3-dioxane, 2-2-bromoethyl,3-bromopropionaldehyde trimethylene acetal,2 2-bromoethyl-1,3-dioxane,2-2-bromoethyl-1,3 dioxane,bromoethyl-1,3-dioxane,acmc-209i3o,2-2-bromoetyl 1,3-dioxane,wmdhqehpovoeog-uhfffaoysa,2-2-bromoethyl 1,3-dioxane PubChem CID: 520656 SMILES: CC(Br)C1OCCCO1
| InChI-Schlüssel | KXMZOKKPQZRPRN-UHFFFAOYNA-N |
|---|---|
| PubChem CID | 520656 |
| CAS | 33884-43-4 |
| MDL-Nummer | MFCD00006567 |
| Molekulargewicht (g/mol) | 195.06 |
| SMILES | CC(Br)C1OCCCO1 |
| Synonym | 2-2-bromoethyl-1,3-dioxane,1,3-dioxane, 2-2-bromoethyl,3-bromopropionaldehyde trimethylene acetal,2 2-bromoethyl-1,3-dioxane,2-2-bromoethyl-1,3 dioxane,bromoethyl-1,3-dioxane,acmc-209i3o,2-2-bromoetyl 1,3-dioxane,wmdhqehpovoeog-uhfffaoysa,2-2-bromoethyl 1,3-dioxane |
| Summenformel | C6H11BrO2 |