man

Test

CAS RN 1012-72-2

CH3H3CCH3CH3H3CCH3

CAS RN 1012-72-2

IUPAC Name: 1,4-di-tert-butylbenzene
Synonyme: 1,4-di-tert-butylbenzene
Molekulargewicht (g/mol): 190.33
Summenformel: C14H22
InChi Key: OOWNNCMFKFBNOF-UHFFFAOYSA-N
SMILES: CC(C)(C)C1=CC=C(C=C1)C(C)(C)C

 Keine Verfeinerungen