Benzoide
Gefilterte Suchergebnisse
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
Vitamin K1, Thermo Scientific Chemicals
CAS: 84-80-0 Summenformel: C31H46O2 Molekulargewicht (g/mol): 450.707 MDL-Nummer: MFCD00214063 InChI-Schlüssel: MBWXNTAXLNYFJB-NKFFZRIASA-N Synonym: vitamin k1,phytonadione,phylloquinone,phytylmenadione,phyllochinon,phytomenadione,alpha-phylloquinone,3-phytylmenadione,konakion,2-methyl-3-phytyl-1,4-naphthoquinone PubChem CID: 5284607 ChEBI: CHEBI:18067 IUPAC-Name: 2-Methyl-3-[(E,7R,11R)-3,7,11,15-Tetramethylhexadec-2-enyl]Naphthalin-1,4-dion SMILES: CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCCC(C)CCCC(C)CCCC(C)C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MBWXNTAXLNYFJB-NKFFZRIASA-N |
|---|---|
| IUPAC-Name | 2-Methyl-3-[(E,7R,11R)-3,7,11,15-Tetramethylhexadec-2-enyl]Naphthalin-1,4-dion |
| PubChem CID | 5284607 |
| CAS | 84-80-0 |
| ChEBI | CHEBI:18067 |
| MDL-Nummer | MFCD00214063 |
| Molekulargewicht (g/mol) | 450.707 |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| Synonym | vitamin k1,phytonadione,phylloquinone,phytylmenadione,phyllochinon,phytomenadione,alpha-phylloquinone,3-phytylmenadione,konakion,2-methyl-3-phytyl-1,4-naphthoquinone |
| Summenformel | C31H46O2 |
Benzoesäure, 99,6 %, ACS-Reagenz
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
Natriumsalicylat, 99 %, Thermo Scientific Chemicals
CAS: 54-21-7 Summenformel: C7H5NaO3 Molekulargewicht (g/mol): 160.104 MDL-Nummer: MFCD00002440 InChI-Schlüssel: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC-Name: Natrium;2-Hydroxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;2-Hydroxybenzoat |
| PubChem CID | 16760658 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| MDL-Nummer | MFCD00002440 |
| Molekulargewicht (g/mol) | 160.104 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| Summenformel | C7H5NaO3 |
2-Phenoxyethanol, 99 %, Thermo Scientific Chemicals
CAS: 122-99-6 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.17 MDL-Nummer: MFCD00002857 InChI-Schlüssel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-Name: 2-Phenoxyethanol SMILES: C1=CC=C(C=C1)OCCO
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Phenoxyethanol |
| PubChem CID | 31236 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| MDL-Nummer | MFCD00002857 |
| Molekulargewicht (g/mol) | 138.17 |
| SMILES | C1=CC=C(C=C1)OCCO |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| Summenformel | C8H10O2 |
Guaiacol, 99+%, Thermo Scientific Chemicals
CAS: 90-05-1 Summenformel: C7H8O2 Molekulargewicht (g/mol): 124.14 InChI-Schlüssel: LHGVFZTZFXWLCP-UHFFFAOYSA-N Synonym: guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid PubChem CID: 460 ChEBI: CHEBI:28591 IUPAC-Name: 2-Methoxyphenol SMILES: COC1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LHGVFZTZFXWLCP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Methoxyphenol |
| PubChem CID | 460 |
| CAS | 90-05-1 |
| ChEBI | CHEBI:28591 |
| Molekulargewicht (g/mol) | 124.14 |
| SMILES | COC1=CC=CC=C1O |
| Synonym | guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid |
| Summenformel | C7H8O2 |
4-Aminobenzoesäure, 99 %, Thermo Scientific Chemicals
CAS: 150-13-0 Summenformel: C7H7NO2 Molekulargewicht (g/mol): 137.14 MDL-Nummer: MFCD00007894 InChI-Schlüssel: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC-Name: 4-Aminobenzoesäure SMILES: NC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Aminobenzoesäure |
| PubChem CID | 978 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| MDL-Nummer | MFCD00007894 |
| Molekulargewicht (g/mol) | 137.14 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| Summenformel | C7H7NO2 |
Calconcarbonsäure, Thermo Scientific Chemicals
CAS: 3737-95-9 Summenformel: C21H14N2O7S Molekulargewicht (g/mol): 438.41 MDL-Nummer: MFCD00004078 InChI-Schlüssel: ULIVOAKVRBXKKS-PYCFMQQDSA-N Synonym: calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn PubChem CID: 5895210 IUPAC-Name: 3-Hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1 -ylidene)hydrazinyl]naphthalin-2-Carboxylsäure SMILES: C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ULIVOAKVRBXKKS-PYCFMQQDSA-N |
|---|---|
| IUPAC-Name | 3-Hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1 -ylidene)hydrazinyl]naphthalin-2-Carboxylsäure |
| PubChem CID | 5895210 |
| CAS | 3737-95-9 |
| MDL-Nummer | MFCD00004078 |
| Molekulargewicht (g/mol) | 438.41 |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
| Synonym | calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn |
| Summenformel | C21H14N2O7S |
alpha-Naphtholbenzein, Thermo Scientific Chemicals
CAS: 145-50-6 Summenformel: C27H18O2 Molekulargewicht (g/mol): 374.439 MDL-Nummer: MFCD00078492 InChI-Schlüssel: VDDWRTZCUJCDJM-PNHLSOANSA-N PubChem CID: 5941340 IUPAC-Name: (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-on SMILES: C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VDDWRTZCUJCDJM-PNHLSOANSA-N |
|---|---|
| IUPAC-Name | (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-on |
| PubChem CID | 5941340 |
| CAS | 145-50-6 |
| MDL-Nummer | MFCD00078492 |
| Molekulargewicht (g/mol) | 374.439 |
| SMILES | C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O |
| Summenformel | C27H18O2 |
Triphenylphosphin, 99 %, Thermo Scientific Chemicals
CAS: 603-35-0 Summenformel: C18H15P Molekulargewicht (g/mol): 262.29 MDL-Nummer: MFCD00003043 MFCD20489348 InChI-Schlüssel: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC-Name: Triphenylphosphan SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triphenylphosphan |
| PubChem CID | 11776 |
| CAS | 603-35-0 |
| MDL-Nummer | MFCD00003043 MFCD20489348 |
| Molekulargewicht (g/mol) | 262.29 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| Summenformel | C18H15P |
Benzylalkohol, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Ethyl 4-hydroxybenzoat, 99 %, Thermo Scientific Chemicals
CAS: 120-47-8 Summenformel: C9H10O3 Molekulargewicht (g/mol): 166.18 MDL-Nummer: MFCD00002353 InChI-Schlüssel: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC-Name: Ethyl 4-Hydroxybenzoat SMILES: CCOC(=O)C1=CC=C(C=C1)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Ethyl 4-Hydroxybenzoat |
| PubChem CID | 8434 |
| CAS | 120-47-8 |
| ChEBI | CHEBI:86616 |
| MDL-Nummer | MFCD00002353 |
| Molekulargewicht (g/mol) | 166.18 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| Summenformel | C9H10O3 |
Methylendi-p-phenyl diisocyanat, 98 %, Flocken, Thermo Scientific Chemicals
CAS: 101-68-8 Summenformel: C15H10N2O2 Molekulargewicht (g/mol): 250.26 MDL-Nummer: MFCD00036131 InChI-Schlüssel: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC-Name: 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol |
| PubChem CID | 7570 |
| CAS | 101-68-8 |
| ChEBI | CHEBI:53218 |
| MDL-Nummer | MFCD00036131 |
| Molekulargewicht (g/mol) | 250.26 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| Summenformel | C15H10N2O2 |
Benzophenon, 99 %, rein, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.22 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| Molekulargewicht (g/mol) | 182.22 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
Benzophenon, 99 %, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.222 MDL-Nummer: MFCD00003076 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| MDL-Nummer | MFCD00003076 |
| Molekulargewicht (g/mol) | 182.222 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |