Triazole ribonucleosides and ribonucleotides

Ribavirin, 98 %, Acros Organics™

Ribavirin, 98 %, Acros Organics™

CAS: 36791-04-5 Summenformel: C8H12N4O5 Molekulargewicht (g/mol): 244.2 InChI-Schlüssel: IWUCXVSUMQZMFG-AFCXAGJDSA-N Synonym: ribavirin, tribavirin, virazole, rebetol, ribavirine, copegus, vilona, ribamide, ribamidil, ribasphere PubChem CID: 37542 ChEBI: CHEBI:63580 IUPAC-Name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide SMILES: C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N

Ribavirin, MP Biomedicals™

Ribavirin, MP Biomedicals™

CAS: 36791-04-5 Summenformel: C8H12N4O5 Molekulargewicht (g/mol): 244.207 InChI-Schlüssel: IWUCXVSUMQZMFG-AFCXAGJDSA-N Synonym: Virazol, Ribavirin, Ribamid, Ribasphäre, ribavirine, copegus, vilona, ribamide, ribamidil, ribasphere PubChem CID: 37542 ChEBI: CHEBI:63580 IUPAC-Name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide SMILES: C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N

  spinner