Seleninic acids and derivatives

Benzolseleninsäureanhydrid, 98 %, Thermo Scientific™

Benzolseleninsäureanhydrid, 98 %, Thermo Scientific™

CAS: 17697-12-0 Summenformel: C12H10O3Se2 Molekulargewicht (g/mol): 360.13 MDL-Nummer: MFCD00001991 InChI-Schlüssel: FHPZOWOEILXXBD-UHFFFAOYSA-N Synonym: 1,3-diphenyldiselenoxane 1,3-dioxide #, bis benzeneseleninic anhydride, benzeneseleninic acid, anhydride, bis phenylseleninic anhydride, benzeneseleninyl benzeneseleninate, benzeneseleninic acid anhydride, benzeneseleninic anhydride PubChem CID: 87253 IUPAC-Name: Phenylseleninyl-benzolseleninat SMILES: C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2
