Furopyrroles

Methyl2-formyl-4-methyl-4H-furo[3,2-b]pyrrol-5-carboxylat, 97 %, Maybridge

Methyl2-formyl-4-methyl-4H-furo[3,2-b]pyrrol-5-carboxylat, 97 %, Maybridge

CAS: 164667-56-5 Summenformel: C10H9NO4 Molekulargewicht (g/mol): 207.185 MDL-Nummer: MFCD08060547 InChI-Schlüssel: VUQKFEPTRLQDRG-UHFFFAOYSA-N Synonym: methyl 2-formyl-4-methyl-4h-furo 3,2-b pyrrole-5-carboxylate, methyl 2-formyl-4-methylfuro 3,2-b pyrrole-5-carboxylate, methyl 2-formyl-4-methylfurano 2,3-d pyrrole-5-carboxylate, 2-formyl-4-methyl-4h-furo 3,2-b pyrrole-5-carboxylic acid methyl ester PubChem CID: 7537673 IUPAC-Name: Methyl-2-formyl-4-methylfuro[3,2-b]pyrrol-5-carboxylat SMILES: CN1C(=CC2=C1C=C(O2)C=O)C(=O)OC

Methyl-4H-furo-[3,2-b]-pyrrol-5-carboxylat, 97 %, Maybridge

Methyl-4H-furo-[3,2-b]-pyrrol-5-carboxylat, 97 %, Maybridge

CAS: 77484-99-2 Summenformel: C8H7NO3 Molekulargewicht (g/mol): 165.15 MDL-Nummer: MFCD06797487 InChI-Schlüssel: LIIJOCBTGRORSY-UHFFFAOYSA-N Synonym: methyl 4h-furo 3,2-b pyrrole-5-carboxylate, 4h-furo 3,2-b pyrrole-5-carboxylic acid methyl ester, methyl furano 2,3-d pyrrole-5-carboxylate, 5-methoxycarbonyl-4h-furo 3,2-b pyrrole, 4h-furo 3,2-b pyrrole-5-carboxylicacid, methyl ester, 4h-furo 3,2-b pyrrole-5-carboxylic acid, methyl ester PubChem CID: 5082263 IUPAC-Name: Methyl 4H-Furo[3,2-b]Pyrrol-5-Carboxylat SMILES: COC(=O)C1=CC2=C(N1)C=CO2

  spinner