Piperazinoazepines

Mirtazapin, 98 %, Acros Organics™

Mirtazapin, 98 %, Acros Organics™

CAS: 85650-52-8 Summenformel: C17H19N3 Molekulargewicht (g/mol): 265.35 InChI-Schlüssel: RONZAEMNMFQXRA-UHFFFAOYSA-N Synonym: mirtazapine, remeron, mepirzepine, remergil, zispin, remergon, rexer, 6-azamianserin, remeron soltab, mepirzapin PubChem CID: 4205 ChEBI: CHEBI:6950 SMILES: CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4

  spinner