Piperazinoazepines

Mirtazapin, 98 %, Thermo Scientific™™

Mirtazapin, 98 %, Thermo Scientific™™

CAS: 85650-52-8 Summenformel: C17H19N3 Molekulargewicht (g/mol): 265.35 InChI-Schlüssel: RONZAEMNMFQXRA-UHFFFAOYSA-N Synonym: mepirzapin, remeron soltab, 6-azamianserin, rexer, remergon, zispin, remergil, mepirzepine, remeron, mirtazapine PubChem CID: 4205 ChEBI: CHEBI:6950 SMILES: CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4

  spinner