
Risperidon, 99 %, Thermo Scientific™™

Risperidon, 99 %, Thermo Scientific™™

CAS: 106266-06-2 Summenformel: C23H27FN4O2 Molekulargewicht (g/mol): 410.49 InChI-Schlüssel: RAPZEAPATHNIPO-UHFFFAOYSA-N Synonym: risperidone, risperidal, risperdal, risperdal consta, rispolept, risperin, rispolin, sequinan, risperidona, risperidonum PubChem CID: 5073 ChEBI: CHEBI:8871 IUPAC-Name: 3-[2-[4-(6-Fluor-1,2-Benzoxazol-3-yl)Piperidin-1-yl]Ethyl]-2-Methyl-6,7,8,9-Tetrahydropyrido[1,2-a]Pyrimidin-4-on SMILES: CC1=C(C(=O)N2CCCCC2=N1)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F
