Thienodiazepines

Thermo Scientific™ Olanzapin

Thermo Scientific™ Olanzapin

CAS: 132539-06-1 Summenformel: C17H20N4S Molekulargewicht (g/mol): 312.44 MDL-Nummer: MFCD00866702 InChI-Schlüssel: WXPNDRBBWZMPQG-UHFFFAOYSA-N IUPAC-Name: 5-methyl-8-(4-methylpiperazin-1-yl)-4-thia-2,9-diazatricyclo[8.4.0.0³,⁷]tetradeca-1(14),2,5,7,10,12-hexaene SMILES: CN1CCN(CC1)C1=C2C=C(C)SC2=NC2=CC=CC=C2N1

  spinner