Sesquiterpenoide
- (2)
- (2)
- (1)
- (3)
- (2)
- (5)
- (2)
- (3)
- (1)
- (1)
- (1)
- (1)
- (2)
- (1)
- (2)
- (1)
- (3)
- (2)
- (1)
- (2)
- (2)
- (3)
- (1)
- (2)
Gefilterte Suchergebnisse
DL-6-Methyl-5 -Hepten-2-ol, 99 %, Thermo Scientific Chemicals
CAS: 6-2-4630 Summenformel: C8H16O Molekulargewicht (g/mol): 128.21 MDL-Nummer: MFCD00004561 InChI-Schlüssel: OHEFFKYYKJVVOX-UHFFFAOYNA-N SMILES: CC(O)CCC=C(C)C
| InChI-Schlüssel | OHEFFKYYKJVVOX-UHFFFAOYNA-N |
|---|---|
| CAS | 6-2-4630 |
| MDL-Nummer | MFCD00004561 |
| Molekulargewicht (g/mol) | 128.21 |
| SMILES | CC(O)CCC=C(C)C |
| Summenformel | C8H16O |
(+)-Nootkaton, kristallin, ≥ 98 %, Thermo Scientific Chemicals
CAS: 4674-50-4 Summenformel: C15H22O Molekulargewicht (g/mol): 218.34 MDL-Nummer: MFCD00036591 InChI-Schlüssel: WTOYNNBCKUYIKC-SLEUVZQESA-N Synonym: unii-zms1vjk5hy,zms1vjk5hy,nootkatone,-,+-nootkatone, crystalline,2 3h-naphthalenone, 4,4a,5,6,7,8-hexahydro-4,4a-dimethyl-6-1-methylethenyl-, 4s,4ar,6s,unii-3k3okv2a5a component,4s,6s,4ar-4,4a-dimethyl-6-1-methylvinyl-3,4,5,6,7,8,4a-heptahydronaphthale n-2-one PubChem CID: 7567181 IUPAC-Name: (4S,4aR,6S)-4,4a-Dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-on SMILES: CC1CC(=O)C=C2C1(CC(CC2)C(=C)C)C
| InChI-Schlüssel | WTOYNNBCKUYIKC-SLEUVZQESA-N |
|---|---|
| IUPAC-Name | (4S,4aR,6S)-4,4a-Dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-on |
| PubChem CID | 7567181 |
| CAS | 4674-50-4 |
| MDL-Nummer | MFCD00036591 |
| Molekulargewicht (g/mol) | 218.34 |
| SMILES | CC1CC(=O)C=C2C1(CC(CC2)C(=C)C)C |
| Synonym | unii-zms1vjk5hy,zms1vjk5hy,nootkatone,-,+-nootkatone, crystalline,2 3h-naphthalenone, 4,4a,5,6,7,8-hexahydro-4,4a-dimethyl-6-1-methylethenyl-, 4s,4ar,6s,unii-3k3okv2a5a component,4s,6s,4ar-4,4a-dimethyl-6-1-methylvinyl-3,4,5,6,7,8,4a-heptahydronaphthale n-2-one |
| Summenformel | C15H22O |
Curdione, MedChemExpress
MedChemExpress Curdione, one of the major sesquiterpene compounds from Rhizoma Curcumae, has been shown to exhibit multiple bioactive properties.
Nicht für den Vertrieb bestimmter Artikel, der individuell angeboten wird; Es können Frachtkosten anfallen.
Weitere Informationen
| Chemischer Name oder Material | Curdione |
|---|---|
| Güte | Research |
| Molekulargewicht (g/mol) | 236.35 |
| SMILES | O=C1C[C@@H](C(C)C)C(C/C(C)=C/CC[C@@H]1C)=O |
| Formelmasse | 236.35 |
| Löslichkeitsinformationen | DMSO : ≥ 100 mg/mL (423.10 mM) |
| Farbe | White |
| Gesundheitsgefahr 1 | H302∣H315∣H319∣H335 |
| Physikalische Form | Solid |
| CAS | 13657-68-6 |
| Hinweise zur Reinheitsqualität | Research |
| Empfohlene Lagerung | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Haltbarkeit | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Reinheit (%) | 98.61% |
| Synonym | (+)-Curdione |
| Summenformel | C15H24O2 |
Guajazulen, 99 %, Thermo Scientific Chemicals
CAS: 489-84-9 Summenformel: C15H18 Molekulargewicht (g/mol): 198.31 InChI-Schlüssel: FWKQNCXZGNBPFD-UHFFFAOYSA-N Synonym: guaiazulene,1,4-dimethyl-7-isopropylazulene,azulon,vetivazulen,azunol,7-isopropyl-1,4-dimethylazulene,eucazulen,guajazulene,kessazulen,purazulen PubChem CID: 3515 ChEBI: CHEBI:5550 IUPAC-Name: 1,4-Dimethyl-7-propan-2-ylazulen SMILES: CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C
| InChI-Schlüssel | FWKQNCXZGNBPFD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,4-Dimethyl-7-propan-2-ylazulen |
| PubChem CID | 3515 |
| CAS | 489-84-9 |
| ChEBI | CHEBI:5550 |
| Molekulargewicht (g/mol) | 198.31 |
| SMILES | CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
| Synonym | guaiazulene,1,4-dimethyl-7-isopropylazulene,azulon,vetivazulen,azunol,7-isopropyl-1,4-dimethylazulene,eucazulen,guajazulene,kessazulen,purazulen |
| Summenformel | C15H18 |
Guajazulen, ≥ 98 %
CAS: 489-84-9 Summenformel: C15H18 Molekulargewicht (g/mol): 198.309 MDL-Nummer: MFCD00003811 InChI-Schlüssel: FWKQNCXZGNBPFD-UHFFFAOYSA-N Synonym: guaiazulene,1,4-dimethyl-7-isopropylazulene,azulon,vetivazulen,azunol,7-isopropyl-1,4-dimethylazulene,eucazulen,guajazulene,kessazulen,purazulen PubChem CID: 3515 ChEBI: CHEBI:5550 IUPAC-Name: 1,4-Dimethyl-7-propan-2-ylazulen SMILES: CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C
| InChI-Schlüssel | FWKQNCXZGNBPFD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,4-Dimethyl-7-propan-2-ylazulen |
| PubChem CID | 3515 |
| CAS | 489-84-9 |
| ChEBI | CHEBI:5550 |
| MDL-Nummer | MFCD00003811 |
| Molekulargewicht (g/mol) | 198.309 |
| SMILES | CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
| Synonym | guaiazulene,1,4-dimethyl-7-isopropylazulene,azulon,vetivazulen,azunol,7-isopropyl-1,4-dimethylazulene,eucazulen,guajazulene,kessazulen,purazulen |
| Summenformel | C15H18 |