
Thermo Scientific™ Omeprazol, ≥ 98 %

Thermo Scientific™ Omeprazol, ≥ 98 %

CAS: 73590-58-6 Summenformel: C17H19N3O3S Molekulargewicht (g/mol): 345.42 InChI-Schlüssel: SUBDBMMJDZJVOS-UHFFFAOYSA-N Synonym: omeprazole, losec, prilosec, antra, esomeprazole, omeprazon, audazol, omapren, omepral, parizac PubChem CID: 4594 ChEBI: CHEBI:77260 IUPAC-Name: 6-Methoxy-2-[(4-Methoxy-3,5-Dimethylpyridin-2-yl)Methylsulfinyl]-1H-Benzimidazol SMILES: CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC

Pantoprazol Natriumsalz Hydrat, Thermo Scientific™™

Pantoprazol Natriumsalz Hydrat, Thermo Scientific™™

CAS: 718635-09-7 Summenformel: C16H14F2N3NaO4S·xH2O Molekulargewicht (g/mol): 405.35 InChI-Schlüssel: CGJRLPRCWSHOFU-UHFFFAOYSA-N Synonym: pantoprazole sodium, pantoprazole sodium hydrate, pantozol hydrate, protonix hydrate, c16h14f2n3nao4s.h2o, sodium pantoprazole 1-hydrate, pantoprazole sodium hydrate hplc, 5-difluoromethoxy-2-3,4-dimethoxypyridin-2-yl methanesulfinyl-1-sodio-1,3-benzodiazole hydrate, 5-difluoromethoxy-2-3,4-dimethoxy-2-pyridinyl methyl sulfinyl-1h-benzimidazole sodium salt hydrate PubChem CID: 23684923 IUPAC-Name: Natrium;5-(Difluormethoxy)-2-[(3,4-Dimethoxypyridin-2-yl)Methylsulfinyl]Benzimidazol-1-id;Hydrat SMILES: COC1=C(C(=NC=C1)CS(=O)C2=NC3=C([N-]2)C=CC(=C3)OC(F)F)OC.O.[Na+]
