
Clozapine, ACROS Orgaincs™

Clozapine, ACROS Orgaincs™

CAS: 5786-21-0 Summenformel: C18H19ClN4 Molekulargewicht (g/mol): 326.83 InChI-Schlüssel: ZUXABONWMNSFBN-UHFFFAOYSA-N IUPAC-Name: 6-Chloro-10-(4-Methylpiperazin-1-yl)-2,9-Diazatricyclo[, Ixil]pentadeda-1,3,5,7,10,12,14-Heptain SMILES: CN1CCN(CC1)C1=C2C=CC=CC2=NC2=CC=C(Cl)C=C2N1
