
Clozapin, Thermo Scientific™™

Clozapin, Thermo Scientific™™

CAS: 5786-21-0 Summenformel: C18H19ClN4 Molekulargewicht (g/mol): 326.83 InChI-Schlüssel: ZUXABONWMNSFBN-UHFFFAOYSA-N IUPAC-Name: 6-Chloro-10-(4-Methylpiperazin-1-yl)-2,9-Diazatricyclo[, Ixil]pentadeda-1,3,5,7,10,12,14-Heptain SMILES: CN1CCN(CC1)C1=C2C=CC=CC2=NC2=CC=C(Cl)C=C2N1

2,3,4,5-Tetrahydro-1H-1,4-benzodiazepin, 95 %, Thermo Scientific™

2,3,4,5-Tetrahydro-1H-1,4-benzodiazepin, 95 %, Thermo Scientific™

CAS: 5946-39-4 Summenformel: C9H12N2 Molekulargewicht (g/mol): 148.209 MDL-Nummer: MFCD03789577 InChI-Schlüssel: MLXBHOCKBUILHN-UHFFFAOYSA-N Synonym: 2,3,4,5-tetrahydro-1h-benzo e 1,4 diazepine, 1h-1,4-benzodiazepine, 2,3,4,5-tetrahydro, 2,3,4,5-tetrahydro-1h benzo e 1,4 diazepine, pubchem14772, acmc-1anok, d0v0nj, tetrahydrobenzo 1,4 diazepine, 2,3,4,5-tetrahydro-1h-1,4-benzodiazepine, 2,3,4,5-tetrahydro-1h-benzo 1,4 diazepine PubChem CID: 2771762 IUPAC-Name: 2,3,4,5-Tetrahydro-1H-1,4-Benzodiazepin SMILES: C1CNC2=CC=CC=C2CN1
