1,2-dithioles

3H-1,2-Benzodithiol-on-1,1-dioxid, 99 %

3H-1,2-Benzodithiol-on-1,1-dioxid, 99 %

CAS: 66304-01-6 Summenformel: C7H4O3S2 Molekulargewicht (g/mol): 200.226 MDL-Nummer: MFCD00132960 InChI-Schlüssel: JUDOLRSMWHVKGX-UHFFFAOYSA-N Synonym: 3h-1,2-benzodithiol-3-one 1,1-dioxide, beaucage reagent, 3h-1,2-benzodithiol-3-one-1,1-dioxide, 3h-benzo c 1,2 dithiol-3-one 1,1-dioxide, 3h-1,2-benzodithiol-3-one, 1,1-dioxide, 1,1-dioxo-1$l^ 6 ,2-benzodithiol-3-one, 3h-1,2-benzodithiol-one 1,1-dioxide, 3h-1,2-benzodithiol-3-one1,1-dioxide, 1??,2-benzodithiole-1,1,3-trione, acmc-1b2sk PubChem CID: 3009847 IUPAC-Name: 1,1-Dioxo-1$l^{6},2-Benzodithiol-3-on SMILES: C1=CC=C2C(=C1)C(=O)SS2(=O)=O

  spinner