
Indomethacin, Acros Organics™

Indomethacin, Acros Organics™

CAS: 53-86-1 Summenformel: C19H16ClNO4 Molekulargewicht (g/mol): 357.79 InChI-Schlüssel: CGIGDMFJXJATDK-UHFFFAOYSA-N Synonym: indomethacin, indometacin, indocin, indometacine, indomethacine, indocid, metindol, amuno, indomethazine, imbrilon PubChem CID: 3715 ChEBI: CHEBI:49662 IUPAC-Name: 2-[1-(4-Chlorbenzoyl)-5-Methoxy-2-Methylindol-3-yl]Ethansäure SMILES: CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O

Indomethacin, 98 %, Alfa Aesar™

Indomethacin, 98 %, Alfa Aesar™

CAS: 53-86-1 Summenformel: C19H16ClNO4 Molekulargewicht (g/mol): 357.79 MDL-Nummer: MFCD00057095 InChI-Schlüssel: CGIGDMFJXJATDK-UHFFFAOYSA-N Synonym: indomethacin, indometacin, indocin, indometacine, indomethacine, indocid, metindol, amuno, indomethazine, imbrilon PubChem CID: 3715 ChEBI: CHEBI:49662 IUPAC-Name: 2-[1-(4-Chlorbenzoyl)-5-Methoxy-2-Methylindol-3-yl]Ethansäure SMILES: CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O
