Benzoylindoles

Thermo Scientific™ Indomethacin

Thermo Scientific™ Indomethacin

CAS: 53-86-1 Summenformel: C19H16ClNO4 Molekulargewicht (g/mol): 357.79 InChI-Schlüssel: CGIGDMFJXJATDK-UHFFFAOYSA-N Synonym: imbrilon, indomethazine, amuno, metindol, indocid, indomethacine, indometacine, indocin, indometacin, indomethacin PubChem CID: 3715 ChEBI: CHEBI:49662 IUPAC-Name: 2-[1-(4-Chlorbenzoyl)-5-Methoxy-2-Methylindol-3-yl]Ethansäure SMILES: CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O

Indomethacin, 98 %, Thermo Scientific™

Indomethacin, 98 %, Thermo Scientific™

CAS: 53-86-1 Summenformel: C19H16ClNO4 Molekulargewicht (g/mol): 357.79 MDL-Nummer: MFCD00057095 InChI-Schlüssel: CGIGDMFJXJATDK-UHFFFAOYSA-N Synonym: imbrilon, indomethazine, amuno, metindol, indocid, indomethacine, indometacine, indocin, indometacin, indomethacin PubChem CID: 3715 ChEBI: CHEBI:49662 IUPAC-Name: 2-[1-(4-Chlorbenzoyl)-5-Methoxy-2-Methylindol-3-yl]Ethansäure SMILES: CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O

  spinner