Benzylisoquinolines

Papaverinhydrochlorid, 99 %, ACROS Organics™

Papaverinhydrochlorid, 99 %, ACROS Organics™

CAS: 61-25-6 Summenformel: C20H21NO4·ClH Molekulargewicht (g/mol): 375.85 MDL-Nummer: MFCD00012745 InChI-Schlüssel: UOTMYNBWXDUBNX-UHFFFAOYSA-N Synonym: papaverine hydrochloride, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan PubChem CID: 6084 IUPAC-Name: 1-[(3,4-Dimethoxyphenyl)Methyl]-6,7-Dimethoxyisochinolin;Hydrochlorid SMILES: COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl

Papaverin Hydrochlorid, 99 %

Papaverin Hydrochlorid, 99 %

CAS: 61-25-6 Summenformel: C20H22ClNO4 Molekulargewicht (g/mol): 375.849 MDL-Nummer: MFCD00012745 InChI-Schlüssel: UOTMYNBWXDUBNX-UHFFFAOYSA-N Synonym: papaverine hydrochloride, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan PubChem CID: 6084 IUPAC-Name: 1-[(3,4-Dimethoxyphenyl)methyl]-6,7-dimethoxyisochinolin;hydrochlorid SMILES: COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl

Palmitelaidinsäure, >99%, MP Biomedicals™

Palmitelaidinsäure, >99%, MP Biomedicals™

CAS: 61-25-6 Summenformel: C20H22ClNO4 Molekulargewicht (g/mol): 375.849 InChI-Schlüssel: UOTMYNBWXDUBNX-UHFFFAOYSA-N Synonym: Papaverinhydrochlorid, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan PubChem CID: 6084 IUPAC-Name: 1-[(3,4-Dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin;hydrochlorid SMILES: COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl

  spinner