Oxaborole derivatives

5-Amino-2-(hydroxymethyl)-benzolboronsäure-hemiester Hydrochlorid, 95 %

5-Amino-2-(hydroxymethyl)-benzolboronsäure-hemiester Hydrochlorid, 95 %

CAS: 117098-93-8 Summenformel: C7H9BClNO2 Molekulargewicht (g/mol): 185.41 MDL-Nummer: MFCD04115645 InChI-Schlüssel: ZDCBDYGPSUVCOU-UHFFFAOYSA-N Synonym: 6-aminobenzo c 1,2 oxaborol-1 3h-ol hydrochloride, 6-amino-1-hydroxy-2,1-benzoxaborolane hydrochloride, 5-amino-2-hydroxymethylphenylboronic acid, hcl, dehydrate, 5-amino-2-hydroxymethylphenyl boronic acid, hcl, dehydrate, 6-amino-3h-2,1-benzoxaborol-1-ol hydrochloride, 1-hydroxy-3h-2,1-benzoxaborol-6-amine hydrochloride, 5-amino-2-hydroxymethylphenyl boronic acid, hydrochloride, dehydrate, 6-amino-1-hydroxy-2,1-benzoxaborolane, hcl, 6-amino-2,1-benzoxaborol-1 3h-ol-hydrogen chloride 1/1, 5-amino-2-hydroxymethylphenyl boronicacid, hcl, dehydrate PubChem CID: 44118730 IUPAC-Name: 1-Hydroxy-3H-2,1-Benzoxaborol-6-Amin;Hydrochlorid SMILES: Cl.NC1=CC2=C(COB2O)C=C1

2-Hydroxymethyl-5-nitrobenzolboronsäurehemiester, 96 %

2-Hydroxymethyl-5-nitrobenzolboronsäurehemiester, 96 %

CAS: 118803-40-0 Summenformel: C7H6BNO4 Molekulargewicht (g/mol): 178.938 MDL-Nummer: MFCD04115657 InChI-Schlüssel: GFFKBQCIGADRSN-UHFFFAOYSA-N Synonym: 6-nitrobenzo c 1,2 oxaborol-1 3h-ol, 1-hydroxy-6-nitro-2,1-benzoxaborolane, 2-hydroxymethyl-5-nitro benzeneboronic acid dehydrate, 6-nitro-3h-2,1-benzoxaborol-1-ol, 6-nitro-1,3-dihydro-2,1-benzoxaborol-1-ol, 2-hydroxymethyl-5-nitro phenylboronic acid, dehydrate, 2-hydroxymethyl-5-nitrophenylboronic acid, dehydrated, 6-nitro-2,1-benzoxaborol-1 3h-ol, 1,3-dihydro-1-hydroxy-6-nitro-2,1-benzoxaborole, 2,1-benzoxaborole,1,3-dihydro-1-hydroxy-6-nitro PubChem CID: 3813634 IUPAC-Name: -1-Hydroxy-6-Nitro-3H-2,1-Benzoxaborol SMILES: B1(C2=C(CO1)C=CC(=C2)[N+](=O)[O-])O
