Pheniramines

Alfa Aesar™ 2-(Methylmercapto)-benzoesäure, 98+ %

Alfa Aesar™ 2-(Methylmercapto)-benzoesäure, 98+ %

CAS: 3724-10-5 Summenformel: C21H29N3O Molekulargewicht (g/mol): 339.48 MDL-Nummer: MFCD00029934 InChI-Schlüssel: UVTNFZQICZKOEM-UHFFFAOYNA-N Synonym: disopyramide, dicorantil, rythmodan, disopiramida, ritmodan, disopyramidum, searle 703, isorythm, lispine, disopyramidum inn-latin PubChem CID: 3114 ChEBI: CHEBI:4657 IUPAC-Name: 4-[Di(Propan-2-yl)Amino]-2-Phenyl-2-Pyridin-2-ylbutanamid SMILES: CC(C)N(CCC(C1=CC=CC=C1)(C2=CC=CC=N2)C(=O)N)C(C)C

  spinner