Aphidicolane and stemodane diterpenoids

Aphidicolin, >99 %, MP Biomedicals™

Aphidicolin, >99 %, MP Biomedicals™

CAS: 38966-21-1 Summenformel: C20H34O4 Molekulargewicht (g/mol): 338.488 InChI-Schlüssel: NOFOAYPPHIUXJR-APNQCZIXSA-N Synonym: 3R,4R,4AR,6AS,8R,9R,11AS,11BS-4,9-Bis hydroxymethyl-4,11b-dimethyltetradecahydro-8,11a-methanocyclohepta a naphthalen-3,9-diol, 9,15-cyclo-c,18-dinor-14,15-secoandrostan-4,17-dimethanol, 3,17-dihydroxy-4-methyl-, 3alpha,4alpha,5alpha,17alpha, +- Aphidicolin, 8,11a-Methano-11ah-cyclohepta a naphthalen-4,9-dimethanol, tetradecahydro-3,9-dihydroxy-4,11b-dimethyl-, 3r-3-alpha,4-alpha,4a-alpha,6a-beta,8-beta,9-beta,11a-beta,11b-beta, 3r,4r,4ar,6as,8r,9r,11as,11bs-4,9-bis hydroxymethyl-4,11b-dimethyltetradecahydro-8,11a-methanocyclohepta a naphthalene-3,9-diol, 9,15-cyclo-c,18-dinor-14,15-secoandrostane-4,17-dimethanol, 3,17-dihydroxy-4-methyl-, 3alpha,4alpha,5alpha,17alpha, +-aphidicolin, 8,11a-methano-11ah-cyclohepta a naphthalene-4,9-dimethanol, tetradecahydro-3,9-dihydroxy-4,11b-dimethyl-, 3r-3-alpha,4-alpha,4a-alpha,6a-beta,8-beta,9-beta,11a-beta,11b-beta, +/--aphidicolin, aphidicolin, +/- PubChem CID: 457964 ChEBI: CHEBI:2766 SMILES: CC12CCC(C(C1CCC3C24CCC(C(C3)C4)(CO)O)(C)CO)O

  spinner