Taxanes and derivatives

Paclitaxel, +99 %, ACROS Organics™

Paclitaxel, +99 %, ACROS Organics™

CAS: 33069-62-4 Summenformel: C47H51NO14 Molekulargewicht (g/mol): 853.92 MDL-Nummer: MFCD00869953 InChI-Schlüssel: RCINICONZNJXQF-VAZQATRQSA-N Synonym: paclitaxel, taxol, taxol a, abraxane, paxene, paxceed, plaxicel, yewtaxan, onxol, ebetaxel PubChem CID: 133640187 IUPAC-Name: (1S,2S,4S,7R,9S,10S,12R,15S)-4,12-bis(Acetyloxy)-1,9-dihydroxy-15-{[(2R,3S)-2-hydroxy-3-phenyl-3-(phenylformamido)propanoyl]oxy}-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹⁰.0⁴,⁷]heptadec-13-en-2-ylbenzoat SMILES: CC(=O)O[C@@H]1C2=C(C)[C@H](C[C@@](O)([C@@H](OC(=O)C3=CC=CC=C3)C3[C@@]4(CO[C@@H]4C[C@H](O)[C@@]3(C)C1=O)OC(C)=O)C2(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)C1=CC=CC=C1)C1=CC=CC=C1

Docetaxel, 98 %, Acros Organics ™

Docetaxel, 98 %, Acros Organics ™

CAS: 114977-28-5 Summenformel: C43H53NO14 Molekulargewicht (g/mol): 807.88 InChI-Schlüssel: ZDZOTLJHXYCWBA-VCVYQWHSSA-N Synonym: docetaxel, taxotere, docetaxel anhydrous, docetaxol, emdoc, docetaxel, trihydrate, docetaxel inn, taxotere tn, unii-699121phca, txl PubChem CID: 148124 ChEBI: CHEBI:4672 SMILES: CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)O

  spinner