N-acylimines

Alfa Aesar™ Isatin-3-Oxim, 97 %

Alfa Aesar™ Isatin-3-Oxim, 97 %

CAS: 607-28-3 Summenformel: C8H6N2O2 Molekulargewicht (g/mol): 162.148 MDL-Nummer: MFCD00014568 InChI-Schlüssel: LNMAXZZQNSPQSR-UHFFFAOYSA-N Synonym: isatin-3-oxime, 3-hydroxyimino indolin-2-one, 1h-indole-2,3-dione 3-oxime, 3-oximeindole-2,3-dione, isatin beta-oxime, 1h-indole-2,3-dione, 3-oxime, 3-hydroxyiminoindolin-2-one, indole-2,3-dione, 3-oxime, 3e-1h-indole-2,3-dione 3-oxime, 3-hydroxyamino indol-2-one PubChem CID: 5351629 IUPAC-Name: 3-(Hydroxyamino)indol-2-on SMILES: C1=CC2=C(C(=O)N=C2C=C1)NO

  spinner