8-prenylated isoflavanones

Rotenon, ≥97 %, MP Biomedicals™

Rotenon, ≥97 %, MP Biomedicals™

CAS: 83-79-4 Summenformel: C23H22O6 Molekulargewicht (g/mol): 394.423 InChI-Schlüssel: JUVIOZPCNVVQFO-HBGVWJBISA-N Synonym: cube root, derris, derrin, --cis-rotenone, barbasco, tubatoxin, --cis-Rotenon, -Rotenon, Kubikwurzel, Rotenon PubChem CID: 6758 ChEBI: CHEBI:28201 SMILES: CC(=C)C1CC2=C(O1)C=CC3=C2OC4COC5=CC(=C(C=C5C4C3=O)OC)OC

  spinner