NMR Solvents

Tetrahydrofuran-d8, für die NMR-Spektroskopie, ≥ 99.5 Atom-% D, ACROS Organics™

Tetrahydrofuran-d8, für die NMR-Spektroskopie, ≥ 99.5 Atom-% D, ACROS Organics™

CAS: 1693-74-9 Summenformel: C4H8O Molekulargewicht (g/mol): 80.16 MDL-Nummer: MFCD00044238 InChI-Schlüssel: WYURNTSHIVDZCO-SVYQBANQSA-N Synonym: tetrahydrofuran-d8, deuterated thf, octadeuterotetrahydrofuran, deuterated tetrahydrofuran, tetrahydrofuran-d8 thf-d8, tetrahydrofuran-d8, >=99.5 atom % d, 2h4 tetrahydro 2h4 furan, thf-d8, 2h8 tetrahydrofuran, furan-d4-, tetrahydro-d4 PubChem CID: 80290 IUPAC-Name: (²H₈)oxolane SMILES: [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H]

Methylsulfoxid-d6, für die NMR-Spektroskopie, enthält 0.03 % TMS, 99.8 Atom-% D, ACROS Organics™

Methylsulfoxid-d6, für die NMR-Spektroskopie, enthält 0.03 % TMS, 99.8 Atom-% D, ACROS Organics™

CAS: 2206-27-1 Summenformel: C2H6OS Molekulargewicht (g/mol): 84.17 MDL-Nummer: MFCD00002090 InChI-Schlüssel: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC-Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]

Methylsulfoxid-d6, für NMR-Spektroskopie, mit 0.03 % TMS, 99.9 Atom-% D, ACROS Organics™

Methylsulfoxid-d6, für NMR-Spektroskopie, mit 0.03 % TMS, 99.9 Atom-% D, ACROS Organics™

CAS: 2206-27-1 Summenformel: C2H6OS Molekulargewicht (g/mol): 84.17 MDL-Nummer: MFCD00002090 InChI-Schlüssel: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC-Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]

Dichlormethan-d2, für die NMR-Spektroskopie, ≥99.8 Atom-% D, ACROS Organics™

Dichlormethan-d2, für die NMR-Spektroskopie, ≥99.8 Atom-% D, ACROS Organics™

CAS: 1665-00-5 Summenformel: CH2Cl2 Molekulargewicht (g/mol): 86.939 MDL-Nummer: MFCD00000882 InChI-Schlüssel: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2, methylene chloride-d2, dichloro 2h2 methane, methane-d2, dichloro, cd2cl2, deuterated dichloromethane, dichloro dideuterio methane, dideuteromethylene chloride, dichloromethane-d2, 99.9 atom % d, dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC-Name: Dichlor(dideuterio)methan SMILES: C(Cl)Cl

Chloroform-d, für die NMR-Spektroskopie, 99.8 Atom-% D, stabilisiert mit Silberfolie, ACROS Organics™

Chloroform-d, für die NMR-Spektroskopie, 99.8 Atom-% D, stabilisiert mit Silberfolie, ACROS Organics™

CAS: 865-49-6 Summenformel: CHCl3 Molekulargewicht (g/mol): 120.375 MDL-Nummer: MFCD00000827 InChI-Schlüssel: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d, deuterochloroform, methane-d, trichloro, 2h chloroform, deuterated chloroform, cdcl3, trichloromethane-d, unii-p1nw4885vt, trichloro deuterio methane, chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC-Name: Trichlor(deuterio)methan SMILES: C(Cl)(Cl)Cl

1,1,2,2-Tetrachlorethan-d2, 99 Atom-% D, ACROS Organics™

1,1,2,2-Tetrachlorethan-d2, 99 Atom-% D, ACROS Organics™

CAS: 33685-54-0 Summenformel: C2H2Cl4 Molekulargewicht (g/mol): 169.85 MDL-Nummer: MFCD00037672 InChI-Schlüssel: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2, 1,2-dideutero-1,1,2,2-tetrachloroethane, tetrachloro 2 h? ethane, 1,1,2,2-tetrachloroethane-d2 tce-d2, ethane-d2, 1,1,2,2-tetrachloro, ethane-1,2-d2, 1,1,2,2-tetrachloro, 1,1,2,2-tetrachloro-1,2-2h2 ethane, de87d, 1,1,2,2-tetrachloroethane-d2 >99.50 atom % d, 1,1,2,2-tetrachloroethane-d2, >=99.5 atom % d PubChem CID: 118531 IUPAC-Name: 1,1,2,2-tetrachlor-1,2-Dideuterioethan SMILES: C(C(Cl)Cl)(Cl)Cl

1,1,2,2-Tetrachlorethan-d2, für die NMR-Spektroskopie, ≥ 99.5 Atom-% D, ACROS Organics™

1,1,2,2-Tetrachlorethan-d2, für die NMR-Spektroskopie, ≥ 99.5 Atom-% D, ACROS Organics™

CAS: 33685-54-0 Summenformel: C2H2Cl4 Molekulargewicht (g/mol): 169.85 MDL-Nummer: MFCD00037672 InChI-Schlüssel: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2, 1,2-dideutero-1,1,2,2-tetrachloroethane, tetrachloro 2 h? ethane, 1,1,2,2-tetrachloroethane-d2 tce-d2, ethane-d2, 1,1,2,2-tetrachloro, ethane-1,2-d2, 1,1,2,2-tetrachloro, 1,1,2,2-tetrachloro-1,2-2h2 ethane, de87d, 1,1,2,2-tetrachloroethane-d2 >99.50 atom % d, 1,1,2,2-tetrachloroethane-d2, >=99.5 atom % d PubChem CID: 118531 IUPAC-Name: 1,1,2,2-tetrachlor-1,2-Dideuterioethan SMILES: C(C(Cl)Cl)(Cl)Cl

Acetonitril-d3, für die NMR-Spektroskopie, enthält 1 v/v% TMS, 99 Atom-% D, ACROS Organics™

Acetonitril-d3, für die NMR-Spektroskopie, enthält 1 v/v% TMS, 99 Atom-% D, ACROS Organics™

CAS: 2206-26-0 Summenformel: C2H3N Molekulargewicht (g/mol): 44.07 MDL-Nummer: MFCD00001881 InChI-Schlüssel: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3, 2h3 acetonitrile, cd3cn, acetonitrile-2,2,2-d3, methyl-d3 cyanide, trideuteroacetonitrile, acetonitrile-d3, 99.8 atom % d, acetonitrile-d3, >=99.8 atom % d, acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC-Name: (²H₃)acetonitrile SMILES: [2H]C([2H])([2H])C#N

1,2-Dichlorobenzol-d4, für die NMR-Spektroskopie, 98 Atom-% D, ACROS Organics™

1,2-Dichlorobenzol-d4, für die NMR-Spektroskopie, 98 Atom-% D, ACROS Organics™

CAS: 2199-69-1 Summenformel: C6H4Cl2 Molekulargewicht (g/mol): 151.02 MDL-Nummer: MFCD00037106 InChI-Schlüssel: RFFLAFLAYFXFSW-RHQRLBAQSA-N Synonym: 1,2-dichlorobenzene-d4, 1,2-dichlorobenzene d4, benzene-1,2,3,4-d4-, 5,6-dichloro, o-dichloro 2h4 benzene, deuterated 1,2-dichlorobenzene, tetradeutero-1,2-dichlorobenzene, 1,2-dichlorobenzene-d4, 98 atom % d, 1,2-dichlorobenzene-d4,98atom%d, benzene-1,2,3,4-d4, 5,6-dichloro, 1,2-dichloro-3,4,5,6-tetradeuterobenzene PubChem CID: 519913 IUPAC-Name: 1,2-Dichlor-3,4,5,6-Tetradeuteriobenzol SMILES: [2H]C1=C([2H])C([2H])=C(Cl)C(Cl)=C1[2H]

Toluol-d8, für die NMR-Spektrometrie, ≥99.5 Atom-% D, ACROS Organics™

Toluol-d8, für die NMR-Spektrometrie, ≥99.5 Atom-% D, ACROS Organics™

CAS: 2037-26-5 Summenformel: C7H8 Molekulargewicht (g/mol): 100.19 MDL-Nummer: MFCD00044638 InChI-Schlüssel: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8, 2h8 toluene, perdeuteriotoluene, benzene-d5, methyl-d3, perdeuterotoluene, benzene-d5-, methyl-d3, 1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene, toluene d8, toluene-d8, 99 atom % d, toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC-Name: 1,2,3,4,5-Pentadeuterio-6-(trideuteriomethyl)Benzol SMILES: CC1=CC=CC=C1

Methanol-d4, für die NMR-Spektroskopie, 99.5 Atom-% D, ACROS Organics™

Methanol-d4, für die NMR-Spektroskopie, 99.5 Atom-% D, ACROS Organics™

CAS: 811-98-3 Summenformel: CH4O Molekulargewicht (g/mol): 36.066 MDL-Nummer: MFCD00044637 InChI-Schlüssel: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4, perdeuteromethanol, tetradeuteromethanol, methan-d3-ol-d, 2h4 methanol, methyl alcohol-d4, cd3od, methyl-d3 alcohol-d, trideuterio deuteriooxy methane, methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC-Name: Trideuterio(deuteriooxy)methan SMILES: CO

Deuteriumoxid, für die NMR-Spektroskopie, 99.8 Atom-% D, ACROS Organics™

Deuteriumoxid, für die NMR-Spektroskopie, 99.8 Atom-% D, ACROS Organics™

CAS: 7789-20-0 Summenformel: H2O Molekulargewicht (g/mol): 20.027 MDL-Nummer: MFCD00044636 InChI-Schlüssel: XLYOFNOQVPJJNP-ZSJDYOACSA-N Synonym: deuterium oxide, water-d2, heavy water, deuterated water, dideuterium oxide, heavy water-d2, heavy water d2o, water sup 2-h2, deuterium oxide usan, water, heavy d2-o PubChem CID: 24602 ChEBI: CHEBI:41981 SMILES: O

Ethanol-d6, für die NMR-Spektroskopie, 99 Atom-% D, ACROS Organics™

Ethanol-d6, für die NMR-Spektroskopie, 99 Atom-% D, ACROS Organics™

CAS: 1516-08-1 Summenformel: C2H6O Molekulargewicht (g/mol): 52.106 MDL-Nummer: MFCD00051020 InChI-Schlüssel: LFQSCWFLJHTTHZ-LIDOUZCJSA-N Synonym: ethanol-d6, 2h6 ethanol, hexadeuteroethanol, 2 h? ethan 2 h ol, ethyl-d5 alcohol-d, ethyl alcohol-d6, ethanol d, ethanol-d6 9ci PubChem CID: 102138 IUPAC-Name: 1,1,1,2,2-pentadeuterio-2-deuteriooxyethan SMILES: CCO

Chloroform-d, für die NMR-Spektroskopie, Atom-99,8 % D, ACROS Organics™

Chloroform-d, für die NMR-Spektroskopie, Atom-99,8 % D, ACROS Organics™

CAS: 865-49-6 Summenformel: CHCl3 Molekulargewicht (g/mol): 120.375 MDL-Nummer: MFCD00000827 InChI-Schlüssel: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: Trichlormethan-D, 2H-Chloroform, Deuteriertes Chloroform, UNII-1NW4885VT, Trichlordeuteriomethan, cdcl3, trichloromethane-d, unii-p1nw4885vt, trichloro deuterio methane, chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC-Name: Trichlor(deuterio)methan SMILES: C(Cl)(Cl)Cl

Toluol-d8, für die NMR-Spektroskopie, +99 Atom-% D, ACROS Organics™

Toluol-d8, für die NMR-Spektroskopie, +99 Atom-% D, ACROS Organics™

CAS: 2037-26-5 Summenformel: C7H8 Molekulargewicht (g/mol): 100.19 MDL-Nummer: MFCD00044638 InChI-Schlüssel: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8, 2h8 toluene, perdeuteriotoluene, benzene-d5, methyl-d3, perdeuterotoluene, benzene-d5-, methyl-d3, 1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene, toluene d8, toluene-d8, 99 atom % d, toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC-Name: 1,2,3,4,5-Pentadeuterio-6-(trideuteriomethyl)Benzol SMILES: CC1=CC=CC=C1

Methylsulfoxid-d6, für die NMR-Spektroskopie, 99.8 Atom-% D, ACROS Organics™

Methylsulfoxid-d6, für die NMR-Spektroskopie, 99.8 Atom-% D, ACROS Organics™

CAS: 2206-27-1 Summenformel: C2H6OS Molekulargewicht (g/mol): 84.17 MDL-Nummer: MFCD00002090 InChI-Schlüssel: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC-Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]

Methylsulfoxid-d6, für die NMR-Spektroskopie, 100.0 Atom-% D, min. 99.96 Atom-% D, ACROS Organics™

Methylsulfoxid-d6, für die NMR-Spektroskopie, 100.0 Atom-% D, min. 99.96 Atom-% D, ACROS Organics™

CAS: 2206-27-1 Summenformel: C2H6OS Molekulargewicht (g/mol): 84.17 MDL-Nummer: MFCD00002090 InChI-Schlüssel: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6, dmso-d6, dimethylsulfoxide-d6, deuterated dmso, methane-d3,sulfinylbis-9ci, methane-d3, sulfinylbis, hexadeuterodimethyl sulfoxide, methane-d3-, sulfinylbis, methanesulfinylmethyl hydrogen, dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC-Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]

Pyridin-d5, für die NMR-Spektroskopie, 100.0 Atom-% D,  ACROS Organics™

Pyridin-d5, für die NMR-Spektroskopie, 100.0 Atom-% D, ACROS Organics™

CAS: 7291-22-7 Summenformel: C5H5N Molekulargewicht (g/mol): 84.13 MDL-Nummer: MFCD00044639 InChI-Schlüssel: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5, 2h5 pyridine, c5d5n, 2 h? pyridine, pyridine d5, pyridine,crude,light, pyridine, perdeutero, ∼2∼h_5_ pyridine, de85c PubChem CID: 558519 IUPAC-Name: (²H₅)pyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]

  spinner