Learn More
Thioflavin T, Thermo Scientific™
Marke: Thermo Scientific Acros 211761000
Weitere Details : CAS : 2390-54-7 Netto-Gewicht : 0.15000kg
| Menge | 100g |
|---|---|
| Verpackung | Glasflasche |
Beschreibung
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 2390-54-7 | |
| 318.863 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 16953 | |
| 4-(3,6-Dimethyl-1,3-Benzothiazol-3-ium-2-yl)-N,N-Dimethylanilin;Chlorid |
| C17H19ClN2S | |
| MFCD00011944 | |
| Basic Yellow 1, C.I. 49005 | |
| CHEBI:76023 | |
| CC1=CC2=C(C=C1)[N+](=C(S2)C3=CC=C(C=C3)N(C)C)C.[Cl-] |
Spezifikation
| Thioflavin T | |
| C17H19ClN2S | |
| 27, 377 | |
| Solubility in water: soluble. Other solubilities: soluble in most organic solvent | |
| Authentic | |
| 4-(3,6-Dimethyl-1,3-Benzothiazol-3-ium-2-yl)-N,N-Dimethylanilin;Chlorid | |
| 16953 | |
| 318.85 | |
| Glasflasche | |
| Complies | |
| 100g |
| 2390-54-7 | |
| MFCD00011944 | |
| Basic Yellow 1, C.I. 49005 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| CC1=CC2=C(C=C1)[N+](=C(S2)C3=CC=C(C=C3)N(C)C)C.[Cl-] | |
| 318.863 | |
| CHEBI:76023 | |
| Pulver | |
| Solubility in water: soluble. Other solubilities: soluble in most organic solvent | |
| Orange-Gelb bis Gelb |
RUO – Research Use Only