Learn More
Trazodone hydrochloride, 98+%, Thermo Scientific™
A serotonin uptake inhibitor
Marke: Thermo Scientific Alfa Aesar J63070.03
| Menge | 1g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 25332-39-2 | |
| 408.327 | |
| OHHDIOKRWWOXMT-UHFFFAOYSA-N | |
| 62935 | |
| 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride |
| C19H23Cl2N5O | |
| MFCD00079603 | |
| trazodone hydrochloride, trazodone hcl, desyrel, bimaran, molipaxin, devidon, pragmazone, thombran, tombran, tritico | |
| CHEBI:9655 | |
| C1CN(CCN1CCCN2C(=O)N3C=CC=CC3=N2)C4=CC(=CC=C4)Cl.Cl |
Spezifikation
| Trazodone hydrochloride | |
| C19H23Cl2N5O | |
| 1g | |
| trazodone hydrochloride, trazodone hcl, desyrel, bimaran, molipaxin, devidon, pragmazone, thombran, tombran, tritico | |
| OHHDIOKRWWOXMT-UHFFFAOYSA-N | |
| 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride | |
| 62935 | |
| 408.33 |
| 25332-39-2 | |
| MFCD00079603 | |
| 14,9579 | |
| Soluble at 25mg/ml in methanol; Also soluble in 0;1M HCl or DMSO; Insoluble in water /n | |
| C1CN(CCN1CCCN2C(=O)N3C=CC=CC3=N2)C4=CC(=CC=C4)Cl.Cl | |
| 408.327 | |
| CHEBI:9655 |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.