1-hydroxylamino, 4-unsubstituted benzenoids

Carbadox, 98+%, Thermo Scientific™

Carbadox, 98+%, Thermo Scientific™

CAS: 6804-07-5 Summenformel: C11H10N4O4 Molekulargewicht (g/mol): 262.23 MDL-Nummer: MFCD00057293 InChI-Schlüssel: BPMVRAQIQQEBLN-UHFFFAOYSA-N Synonym: carbadox, unii-m2x04r2e2y, getroxel, mecadox, dsstox_cid_23913, dsstox_rid_80088, dsstox_gsid_43913, fortigro, karbadox czech, methyl n-e-1-hydroxy-4-oxidoquinoxalin-4-ium-2-ylidene methyl iminocarbamate PubChem CID: 5353472 IUPAC-Name: methyl N-[(E)-(1-hydroxy-4-oxidoquinoxalin-4-ium-2-ylidene)methyl]iminocarbamat SMILES: COC(=O)N=NC=C1C=[N+](C2=CC=CC=C2N1O)[O-]

  spinner