
5,7,12,14-Pentacenettron, 98+%, Thermo Scientific™

5,7,12,14-Pentacenettron, 98+%, Thermo Scientific™

CAS: 23912-79-0 Summenformel: C22H10O4 Molekulargewicht (g/mol): 338.318 MDL-Nummer: MFCD00075209 InChI-Schlüssel: YZOGOBWHTVNKGA-UHFFFAOYSA-N Synonym: 5,7,12,14-pentacenetetrone, 2.3-phthalylanthrachinon, pentacene-5,7,12,14-tetraone, 5,7,12,14-tetraoxo-5,7,12,14-tetrahydropentacene, 5,7,12,14-tetrahydropentacene-5,7,12,14-tetrone PubChem CID: 4733 IUPAC-Name: pentacene-5,7,12,14-tetrone SMILES: C1=CC=C2C(=C1)C(=O)C3=CC4=C(C=C3C2=O)C(=O)C5=CC=CC=C5C4=O

6,13-Pentacenchinon, 99 %, Thermo Scientific™

6,13-Pentacenchinon, 99 %, Thermo Scientific™

CAS: 3029-32-1 Summenformel: C22H12O2 Molekulargewicht (g/mol): 308.34 MDL-Nummer: MFCD00003709 InChI-Schlüssel: UFCVADNIXDUEFZ-UHFFFAOYSA-N Synonym: 6,13-pentacenequinone, 6,13-pentacenedione, acmc-209hec, ufcvadnixduefz-uhfffaoysa PubChem CID: 76415 IUPAC-Name: Pentan-6,13-Dion SMILES: C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC5=CC=CC=C5C=C4C3=O
