Aryltetralin lignans

Etoposid, MP Biomedicals

Etoposid, MP Biomedicals

CAS: 33419-42-0 Summenformel: C29H32O13 Molekulargewicht (g/mol): 588.56 MDL-Nummer: MFCD00869325,MFCD00869325 InChI-Schlüssel: VJJPUSNTGOMMGY-MRVIYFEKSA-N Synonym: vjjpusntgommgy-nzlmilqcsa PubChem CID: 50936917 IUPAC-Name: (9R)-5-[[(2R,6R,7R,8R)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-on SMILES: COC1=CC(=CC(OC)=C1O)[C@H]1[C@@H]2[C@H](COC2=O)[C@H](O[C@@H]2O[C@@H]3CO[C@@H](C)O[C@H]3[C@H](O)[C@H]2O)C2=CC3=C(OCO3)C=C12

  spinner