2-phenoxypropionic acids

2-(2,4,5-Trichlorphenoxy)Propionsäure, 96 %, Thermo Scientific™

2-(2,4,5-Trichlorphenoxy)Propionsäure, 96 %, Thermo Scientific™

CAS: 93-72-1 Summenformel: C9H7Cl3O3 Molekulargewicht (g/mol): 269.50 MDL-Nummer: MFCD00002646 InChI-Schlüssel: ZLSWBLPERHFHIS-UHFFFAOYNA-N Synonym: fenoprop, silvex, 2-2,4,5-trichlorophenoxy propionic acid, double strength, fenormone, propon, color-set, aqua-vex, sta-fast, fruitone t PubChem CID: 7158 ChEBI: CHEBI:34758 IUPAC-Name: 2-(2,4,5-Trichlorphenoxy)Propansäure SMILES: CC(OC1=CC(Cl)=C(Cl)C=C1Cl)C(O)=O
