Bile acids, alcohols and derivatives

Natriumglycocholathydrat, 98 %, Thermo Scientific™

Natriumglycocholathydrat, 98 %, Thermo Scientific™

CAS: 207614-05-9 Summenformel: C26H46NNaO8 Molekulargewicht (g/mol): 523.643 MDL-Nummer: MFCD09037360 InChI-Schlüssel: SDTQNTQLAZRSIC-NWNSWQEHSA-M Synonym: sodium glycocholate dihydrate,, sodium glycocholate hydrate, glycocholic acid sodium salt hydrate PubChem CID: 45051920 IUPAC-Name: Natrium; 2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-Trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetat; Dihydrat SMILES: CC(CCC(=O)NCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.O.[Na+]

20-Hydroxyecdyson, ≥95 %, MP Biomedicals™

20-Hydroxyecdyson, ≥95 %, MP Biomedicals™

CAS: 5289-74-7 Summenformel: C27H44O7 Molekulargewicht (g/mol): 480.64 MDL-Nummer: MFCD00036740 InChI-Schlüssel: NKDFYOWSKOHCCO-YPVLXUMRSA-N Synonym: crustecdyson, commisterone, Commisteron, Insektenhäutungshormon, Polypodin A, 20-OH-Ecdyson, Crustecdyson, beta-Ekdyson, Ecdysteron, 20-Hydroxyecdyson PubChem CID: 5459840 ChEBI: CHEBI:16587 IUPAC-Name: (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-Trihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-on SMILES: CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C
