Halogenated steroids

Fluoxymesteron, Thermo Scientific™™

Fluoxymesteron, Thermo Scientific™™

CAS: 76-43-7 Summenformel: C20H29FO3 Molekulargewicht (g/mol): 336.447 InChI-Schlüssel: YLRFCQOZQXIBAB-RBZZARIASA-N Synonym: fluoxymesterone, fluoximesterone, fluoxymestrone, halotestin, androfluorene, androfluorone, fluotestin, androsterolo, fluosterone, flusteron PubChem CID: 6446 ChEBI: CHEBI:5120 IUPAC-Name: (8S,9R,10S,11S,13S,14S,17S)-9-Fluor-11,17-dihydroxy-10,13,17-trimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-on SMILES: CC12CCC(=O)C=C1CCC3C2(C(CC4(C3CCC4(C)O)C)O)F
