
Fumonisin B1, 96 %, Thermo Scientific™

Fumonisin B1, 96 %, Thermo Scientific™

CAS: 116355-83-0 Summenformel: C34H59NO15 Molekulargewicht (g/mol): 721.8 MDL-Nummer: MFCD00133349 InChI-Schlüssel: UVBUBMSSQKOIBE-UWCNXKJPSA-N Synonym: 2s-2-2-5r,6r,7s,9s,11r,16r,18s,19s-19-amino-6-3r-3,4-dicarboxybutanoyl oxy-11,16,18-trihydroxy-5,9-dimethylicosan-7-yl oxy-2-oxoethyl butanedioic acid, 2r,2'r-1,2,3-propanetricarboxylic acid 1,1'-1s,2r-1-2s,4r,9r,11s,12s-12-amino-4,9,11-trihydroxy-2-methyltridecyl-2-1r-1-methylpentyl-1,2-ethanediyl ester, fumonisin b1, macrofusine PubChem CID: 16760030 IUPAC-Name: (2S)-2-[2-[(5R,6R,7S,9S,11R,16R,18S,19S)-19-Amino-6-[(3R)-3,4-dicarboxybutanoyl]oxy-11,16,18-trihydroxy-5,9-dimethylicosan-7-yl]oxy-2-oxoethyl]butandisäure SMILES: CCCCC(C)C(C(CC(C)CC(CCCCC(CC(C(C)N)O)O)O)OC(=O)CC(CC(=O)O)C(=O)O)OC(=O)CC(CC(=O)O)C(=O)O
