2-benzimidazolylcarbamic acid esters

Alfa Aesar™ Albendazol, ≥ 98 %

Alfa Aesar™ Albendazol, ≥ 98 %

CAS: 54965-21-8 Summenformel: C12H15N3O2S Molekulargewicht (g/mol): 265.33 MDL-Nummer: MFCD00083232 InChI-Schlüssel: HXHWSAZORRCQMX-UHFFFAOYSA-N Synonym: albendazole, albenza, eskazole, valbazen, zentel, albendazol, proftril, albendazolum, bilutac, zental PubChem CID: 2082 ChEBI: CHEBI:16664 IUPAC-Name: Methyl N-(6-Propylsulfanyl-1H-Benzimidazol-2-yl)Carbamat SMILES: CCCSC1=CC=C2N=C(NC(=O)OC)NC2=C1

  spinner