2-benzimidazolylcarbamic acid esters

Albendazol, ≥ 98 %, Thermo Scientific™

Albendazol, ≥ 98 %, Thermo Scientific™

CAS: 54965-21-8 Summenformel: C12H15N3O2S Molekulargewicht (g/mol): 265.33 MDL-Nummer: MFCD00083232 InChI-Schlüssel: HXHWSAZORRCQMX-UHFFFAOYSA-N Synonym: zental, bilutac, albendazolum, proftril, albendazol, zentel, valbazen, eskazole, albenza, albendazole PubChem CID: 2082 ChEBI: CHEBI:16664 IUPAC-Name: Methyl N-(6-Propylsulfanyl-1H-Benzimidazol-2-yl)Carbamat SMILES: CCCSC1=CC=C2N=C(NC(=O)OC)NC2=C1

  spinner